EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H9NO3 |
| Net Charge | 0 |
| Average Mass | 119.120 |
| Monoisotopic Mass | 119.05824 |
| SMILES | N[C@@H](CCO)C(=O)O |
| InChI | InChI=1S/C4H9NO3/c5-3(1-2-6)4(7)8/h3,6H,1-2,5H2,(H,7,8)/t3-/m0/s1 |
| InChIKey | UKAUYVFTDYCKQA-VKHMYHEASA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chlamydomonas reinhardtii (ncbitaxon:3055) | - | PubMed (25515814) | |
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-homoserine (CHEBI:15699) has role Escherichia coli metabolite (CHEBI:76971) |
| L-homoserine (CHEBI:15699) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| L-homoserine (CHEBI:15699) has role algal metabolite (CHEBI:84735) |
| L-homoserine (CHEBI:15699) has role human metabolite (CHEBI:77746) |
| L-homoserine (CHEBI:15699) is a homoserine (CHEBI:30653) |
| L-homoserine (CHEBI:15699) is enantiomer of D-homoserine (CHEBI:30654) |
| L-homoserine (CHEBI:15699) is tautomer of L-homoserine zwitterion (CHEBI:57476) |
| Incoming Relation(s) |
| N-(octanoyl)-L-homoserine (CHEBI:74404) has functional parent L-homoserine (CHEBI:15699) |
| N-heptanoyl-L-homoserine (CHEBI:85607) has functional parent L-homoserine (CHEBI:15699) |
| O-acetyl-L-homoserine (CHEBI:16288) has functional parent L-homoserine (CHEBI:15699) |
| L-canaline (CHEBI:41401) has functional parent L-homoserine (CHEBI:15699) |
| L-canavanine (CHEBI:609827) has functional parent L-homoserine (CHEBI:15699) |
| isonocardicin A (CHEBI:16483) has functional parent L-homoserine (CHEBI:15699) |
| isonocardicin C (CHEBI:81022) has functional parent L-homoserine (CHEBI:15699) |
| D-homoserine (CHEBI:30654) is enantiomer of L-homoserine (CHEBI:15699) |
| L-homoserine zwitterion (CHEBI:57476) is tautomer of L-homoserine (CHEBI:15699) |
| IUPAC Name |
|---|
| L-homoserine |
| Synonyms | Source |
|---|---|
| 2-Amino-4-hydroxybutanoic acid | HMDB |
| 2-Amino-4-hydroxybutyric acid | KEGG COMPOUND |
| (2S)-2-amino-4-hydroxybutanoic acid | IUPAC |
| Homoserine | HMDB |
| L-Homoserine | KEGG COMPOUND |
| L-HOMOSERINE | PDBeChem |
| Manual Xrefs | Databases |
|---|---|
| C00001366 | KNApSAcK |
| C00263 | KEGG COMPOUND |
| DB04193 | DrugBank |
| HMDB0000719 | HMDB |
| HOMO-SER | MetaCyc |
| Homoserine | Wikipedia |
| HSE | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1721681 | Reaxys |
| CAS:672-15-1 | ChemIDplus |
| CAS:672-15-1 | KEGG COMPOUND |
| Citations |
|---|