EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H9NO3 |
| Net Charge | 0 |
| Average Mass | 119.120 |
| Monoisotopic Mass | 119.05824 |
| SMILES | N[C@@H](CCO)C(=O)O |
| InChI | InChI=1S/C4H9NO3/c5-3(1-2-6)4(7)8/h3,6H,1-2,5H2,(H,7,8)/t3-/m0/s1 |
| InChIKey | UKAUYVFTDYCKQA-VKHMYHEASA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chlamydomonas reinhardtii (ncbitaxon:3055) | - | PubMed (25515814) | |
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-homoserine (CHEBI:15699) has role Escherichia coli metabolite (CHEBI:76971) |
| L-homoserine (CHEBI:15699) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| L-homoserine (CHEBI:15699) has role algal metabolite (CHEBI:84735) |
| L-homoserine (CHEBI:15699) has role human metabolite (CHEBI:77746) |
| L-homoserine (CHEBI:15699) is a homoserine (CHEBI:30653) |
| L-homoserine (CHEBI:15699) is enantiomer of D-homoserine (CHEBI:30654) |
| L-homoserine (CHEBI:15699) is tautomer of L-homoserine zwitterion (CHEBI:57476) |
| Incoming Relation(s) |
| N-(octanoyl)-L-homoserine (CHEBI:74404) has functional parent L-homoserine (CHEBI:15699) |
| N-heptanoyl-L-homoserine (CHEBI:85607) has functional parent L-homoserine (CHEBI:15699) |
| O-acetyl-L-homoserine (CHEBI:16288) has functional parent L-homoserine (CHEBI:15699) |
| L-canaline (CHEBI:41401) has functional parent L-homoserine (CHEBI:15699) |
| L-canavanine (CHEBI:609827) has functional parent L-homoserine (CHEBI:15699) |
| isonocardicin A (CHEBI:16483) has functional parent L-homoserine (CHEBI:15699) |
| isonocardicin C (CHEBI:81022) has functional parent L-homoserine (CHEBI:15699) |
| D-homoserine (CHEBI:30654) is enantiomer of L-homoserine (CHEBI:15699) |
| L-homoserine zwitterion (CHEBI:57476) is tautomer of L-homoserine (CHEBI:15699) |
| IUPAC Name |
|---|
| L-homoserine |
| Synonyms | Source |
|---|---|
| 2-Amino-4-hydroxybutanoic acid | HMDB |
| 2-Amino-4-hydroxybutyric acid | KEGG COMPOUND |
| (2S)-2-amino-4-hydroxybutanoic acid | IUPAC |
| Homoserine | HMDB |
| L-Homoserine | KEGG COMPOUND |
| L-HOMOSERINE | PDBeChem |
| Manual Xrefs | Databases |
|---|---|
| C00001366 | KNApSAcK |
| C00263 | KEGG COMPOUND |
| DB04193 | DrugBank |
| HMDB0000719 | HMDB |
| HOMO-SER | MetaCyc |
| Homoserine | Wikipedia |
| HSE | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1721681 | Reaxys |
| CAS:672-15-1 | ChemIDplus |
| CAS:672-15-1 | KEGG COMPOUND |
| Citations |
|---|