EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:30653 - homoserine
| Formula | C4H9NO3 |
| Net Charge | 0 |
| Average Mass | 119.120 |
| Monoisotopic Mass | 119.05824 |
| SMILES | NC(CCO)C(=O)O |
| InChI | InChI=1S/C4H9NO3/c5-3(1-2-6)4(7)8/h3,6H,1-2,5H2,(H,7,8) |
| InChIKey | UKAUYVFTDYCKQA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| homoserine (CHEBI:30653) has role metabolite (CHEBI:25212) |
| homoserine (CHEBI:30653) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| homoserine (CHEBI:30653) is conjugate acid of homoserinate (CHEBI:62980) |
| Incoming Relation(s) |
| N-acylhomoserine (CHEBI:55414) has functional parent homoserine (CHEBI:30653) |
| O-acetylhomoserine (CHEBI:7671) has functional parent homoserine (CHEBI:30653) |
| D-homoserine (CHEBI:30654) is a homoserine (CHEBI:30653) |
| L-homoserine (CHEBI:15699) is a homoserine (CHEBI:30653) |
| homoserinate (CHEBI:62980) is conjugate base of homoserine (CHEBI:30653) |
| IUPAC Name |
|---|
| homoserine |
| Synonyms | Source |
|---|---|
| 2-amino-4-hydroxybutanoic acid | IUPAC |
| Hse | IUPAC |
| DL-Homoserine | ChemIDplus |
| Citations |
|---|