EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H12N4O3 |
| Net Charge | 0 |
| Average Mass | 176.176 |
| Monoisotopic Mass | 176.09094 |
| SMILES | N=C(N)NOCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C5H12N4O3/c6-3(4(10)11)1-2-12-9-5(7)8/h3H,1-2,6H2,(H,10,11)(H4,7,8,9)/t3-/m0/s1 |
| InChIKey | FSBIGDSBMBYOPN-VKHMYHEASA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | phytogenic insecticide An insecticide compound naturally occurring in plants. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-canavanine (CHEBI:609827) has functional parent L-homoserine (CHEBI:15699) |
| L-canavanine (CHEBI:609827) has role phytogenic insecticide (CHEBI:22917) |
| L-canavanine (CHEBI:609827) has role plant metabolite (CHEBI:76924) |
| L-canavanine (CHEBI:609827) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| L-canavanine (CHEBI:609827) is conjugate base of L-canavanine(1+) (CHEBI:78902) |
| L-canavanine (CHEBI:609827) is tautomer of L-canavanine zwitterion (CHEBI:405237) |
| Incoming Relation(s) |
| L-canavanine(1+) (CHEBI:78902) is conjugate acid of L-canavanine (CHEBI:609827) |
| L-canavanine zwitterion (CHEBI:405237) is tautomer of L-canavanine (CHEBI:609827) |
| IUPAC Name |
|---|
| O-carbamimidamido-L-homoserine |
| Synonyms | Source |
|---|---|
| 2-Amino-4-(guanidinooxy)butyric acid | ChemIDplus |
| Canavanine | KEGG COMPOUND |
| L-Canavanine | KEGG COMPOUND |
| L-CANAVANINE | PDBeChem |
| O-((Aminoiminomethyl)amino)-L-homoserine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C00001347 | KNApSAcK |
| C00308 | KEGG COMPOUND |
| Canavanine | Wikipedia |
| CANAVANINE | MetaCyc |
| GGB | PDBeChem |
| HMDB0002706 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1726113 | Reaxys |
| CAS:543-38-4 | KEGG COMPOUND |
| CAS:543-38-4 | ChemIDplus |
| Citations |
|---|