EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H21NO4 |
| Net Charge | 0 |
| Average Mass | 231.292 |
| Monoisotopic Mass | 231.14706 |
| SMILES | CCCCCCC(=O)N[C@@H](CCO)C(=O)O |
| InChI | InChI=1S/C11H21NO4/c1-2-3-4-5-6-10(14)12-9(7-8-13)11(15)16/h9,13H,2-8H2,1H3,(H,12,14)(H,15,16)/t9-/m0/s1 |
| InChIKey | RVOWFRGAKGPNMK-VIFPVBQESA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-heptanoyl-L-homoserine (CHEBI:85607) has functional parent L-homoserine (CHEBI:15699) |
| N-heptanoyl-L-homoserine (CHEBI:85607) is a N-acyl-L-amino acid (CHEBI:21644) |
| N-heptanoyl-L-homoserine (CHEBI:85607) is a non-proteinogenic amino acid derivative (CHEBI:83812) |
| IUPAC Name |
|---|
| N-heptanoyl-L-homoserine |
| Synonym | Source |
|---|---|
| N-(heptanoyl)-L-homoserine | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:23868447 | Reaxys |
| Citations |
|---|