EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H24N4O9 |
| Net Charge | 0 |
| Average Mass | 500.464 |
| Monoisotopic Mass | 500.15433 |
| SMILES | N[C@@H](CCOc1ccc(/C(=N/O)C(=O)N[C@H]2CN([C@@H](C(=O)O)c3ccc(O)cc3)C2=O)cc1)C(=O)O |
| InChI | InChI=1S/C23H24N4O9/c24-16(22(31)32)9-10-36-15-7-3-12(4-8-15)18(26-35)20(29)25-17-11-27(21(17)30)19(23(33)34)13-1-5-14(28)6-2-13/h1-8,16-17,19,28,35H,9-11,24H2,(H,25,29)(H,31,32)(H,33,34)/b26-18-/t16-,17-,19+/m0/s1 |
| InChIKey | CTNZOGJNVIFEBA-MOKAZRKYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isonocardicin A (CHEBI:16483) has functional parent D-4-hydroxyphenylglycine (CHEBI:15695) |
| isonocardicin A (CHEBI:16483) has functional parent L-homoserine (CHEBI:15699) |
| isonocardicin A (CHEBI:16483) is a aromatic ether (CHEBI:35618) |
| isonocardicin A (CHEBI:16483) is a dicarboxylic acid (CHEBI:35692) |
| isonocardicin A (CHEBI:16483) is a nocardicin (CHEBI:25572) |
| isonocardicin A (CHEBI:16483) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| isonocardicin A (CHEBI:16483) is a phenols (CHEBI:33853) |
| isonocardicin A (CHEBI:16483) is tautomer of isonocardicin A zwitterion (CHEBI:142510) |
| Incoming Relation(s) |
| isonocardicin A zwitterion (CHEBI:142510) is tautomer of isonocardicin A (CHEBI:16483) |
| IUPAC Name |
|---|
| O-{4-[(1Z)-2-({(3S)-1-[(R)-carboxy(4-hydroxyphenyl)methyl]-2-oxoazetidin-3-yl}amino)-N-hydroxy-2-oxoethanimidoyl]phenyl}-L-homoserine |
| Synonyms | Source |
|---|---|
| isonocardicin A | KEGG COMPOUND |
| 1-azetidineacetic acid | KEGG COMPOUND |
| Citations |
|---|