EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H10N2O3 |
| Net Charge | 0 |
| Average Mass | 134.135 |
| Monoisotopic Mass | 134.06914 |
| SMILES | NOCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C4H10N2O3/c5-3(4(7)8)1-2-9-6/h3H,1-2,5-6H2,(H,7,8)/t3-/m0/s1 |
| InChIKey | FQPGMQABJNQLLF-VKHMYHEASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Canavalia ensiformis (ncbitaxon:3823) | - | DOI (/10.1021/jf00087a004) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antimetabolite A substance which is structurally similar to a metabolite but which competes with it or replaces it, and so prevents or reduces its normal utilization. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Applications: | phytogenic insecticide An insecticide compound naturally occurring in plants. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-canaline (CHEBI:41401) has functional parent L-homoserine (CHEBI:15699) |
| L-canaline (CHEBI:41401) has role antimetabolite (CHEBI:35221) |
| L-canaline (CHEBI:41401) has role antineoplastic agent (CHEBI:35610) |
| L-canaline (CHEBI:41401) has role phytogenic insecticide (CHEBI:22917) |
| L-canaline (CHEBI:41401) has role plant metabolite (CHEBI:76924) |
| L-canaline (CHEBI:41401) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| L-canaline (CHEBI:41401) is tautomer of L-canaline zwitterion (CHEBI:145769) |
| Incoming Relation(s) |
| L-canaline zwitterion (CHEBI:145769) is tautomer of L-canaline (CHEBI:41401) |
| IUPAC Name |
|---|
| O-amino-L-homoserine |
| Synonyms | Source |
|---|---|
| (2S)-2-amino-4-(aminooxy)butanoic acid | IUPAC |
| (2S)-2-amino-4-(aminooxy)butyric acid | HMDB |
| canaline | ChemIDplus |
| L-2-amino-4-(aminooxy)butyric acid | MetaCyc |
| L-canaline | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C00001346 | KNApSAcK |
| C08270 | KEGG COMPOUND |
| CAN | PDBeChem |
| DB02821 | DrugBank |
| FDB030959 | FooDB |
| HMDB0012251 | HMDB |
| L-CANALINE | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| CAS:496-93-5 | ChemIDplus |
| Citations |
|---|