EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:81022 - isonocardicin C
| Formula | C23H26N4O8 |
| Net Charge | 0 |
| Average Mass | 486.481 |
| Monoisotopic Mass | 486.17506 |
| SMILES | N[C@@H](CCOc1ccc([C@@H](N)C(=O)N[C@H]2CN([C@@H](C(=O)O)c3ccc(O)cc3)C2=O)cc1)C(=O)O |
| InChI | InChI=1S/C23H26N4O8/c24-16(22(31)32)9-10-35-15-7-3-12(4-8-15)18(25)20(29)26-17-11-27(21(17)30)19(23(33)34)13-1-5-14(28)6-2-13/h1-8,16-19,28H,9-11,24-25H2,(H,26,29)(H,31,32)(H,33,34)/t16-,17-,18+,19+/m0/s1 |
| InChIKey | CWTCWGGPTVMMLT-INDMIFKZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Nocardia uniformis subsp. tsuyamanensis (ncbitaxon:96045) | - | PubMed (15252031) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isonocardicin C (CHEBI:81022) has functional parent L-homoserine (CHEBI:15699) |
| isonocardicin C (CHEBI:81022) has role bacterial metabolite (CHEBI:76969) |
| isonocardicin C (CHEBI:81022) is a dicarboxylic acid (CHEBI:35692) |
| isonocardicin C (CHEBI:81022) is a monobactam (CHEBI:50695) |
| isonocardicin C (CHEBI:81022) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| isonocardicin C (CHEBI:81022) is a phenols (CHEBI:33853) |
| isonocardicin C (CHEBI:81022) is tautomer of isonocardicin C dizwitterion (CHEBI:131920) |
| Incoming Relation(s) |
| isonocardicin C dizwitterion (CHEBI:131920) is tautomer of isonocardicin C (CHEBI:81022) |
| IUPAC Name |
|---|
| O-{4-[(1R)-1-amino-2-({(3S)-1-[(R)-carboxy(4-hydroxyphenyl)methyl]-2-oxoazetidin-3-yl}amino)-2-oxoethyl]phenyl}-L-homoserine |
| Citations |
|---|