EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H9NO3 |
| Net Charge | 0 |
| Average Mass | 119.120 |
| Monoisotopic Mass | 119.05824 |
| SMILES | N[C@H](CCO)C(=O)O |
| InChI | InChI=1S/C4H9NO3/c5-3(1-2-6)4(7)8/h3,6H,1-2,5H2,(H,7,8)/t3-/m1/s1 |
| InChIKey | UKAUYVFTDYCKQA-GSVOUGTGSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-homoserine (CHEBI:30654) is a D-α-amino acid (CHEBI:16733) |
| D-homoserine (CHEBI:30654) is a homoserine (CHEBI:30653) |
| D-homoserine (CHEBI:30654) is enantiomer of L-homoserine (CHEBI:15699) |
| D-homoserine (CHEBI:30654) is tautomer of D-homoserine zwitterion (CHEBI:143081) |
| Incoming Relation(s) |
| O-acetyl-D-homoserine (CHEBI:37034) has functional parent D-homoserine (CHEBI:30654) |
| nocardicin C (CHEBI:81021) has functional parent D-homoserine (CHEBI:30654) |
| L-homoserine (CHEBI:15699) is enantiomer of D-homoserine (CHEBI:30654) |
| D-homoserine zwitterion (CHEBI:143081) is tautomer of D-homoserine (CHEBI:30654) |
| IUPAC Name |
|---|
| D-homoserine |
| Synonym | Source |
|---|---|
| (2R)-2-amino-4-hydroxybutanoic acid | IUPAC |
| Manual Xrefs | Databases |
|---|---|
| CPD-12255 | MetaCyc |
| JP2008022844 | Patent |
| CN101333175 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1721680 | Reaxys |
| CAS:6027-21-0 | ChemIDplus |
| Citations |
|---|