EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H8O |
| Net Charge | 0 |
| Average Mass | 144.173 |
| Monoisotopic Mass | 144.05751 |
| SMILES | Oc1ccc2ccccc2c1 |
| InChI | InChI=1S/C10H8O/c11-10-6-5-8-3-1-2-4-9(8)7-10/h1-7,11H |
| InChIKey | JWAZRIHNYRIHIV-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | urine (BTO:0001419) | PubMed (22815468) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Chemical Roles: | radical scavenger A role played by a substance that can react readily with, and thereby eliminate, radicals. electron donor A molecular entity that can transfer an electron to another molecular entity. |
| Biological Roles: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. genotoxin A role played by a chemical compound to induce direct or indirect DNA damage. Such damage can potentially lead to the formation of a malignant tumour, but DNA damage does not lead inevitably to the creation of cancerous cells. |
| Application: | antinematodal drug A substance used in the treatment or control of nematode infestations. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-naphthol (CHEBI:10432) has role antinematodal drug (CHEBI:35444) |
| 2-naphthol (CHEBI:10432) has role genotoxin (CHEBI:50902) |
| 2-naphthol (CHEBI:10432) has role human urinary metabolite (CHEBI:84087) |
| 2-naphthol (CHEBI:10432) has role human xenobiotic metabolite (CHEBI:76967) |
| 2-naphthol (CHEBI:10432) has role mouse metabolite (CHEBI:75771) |
| 2-naphthol (CHEBI:10432) has role radical scavenger (CHEBI:48578) |
| 2-naphthol (CHEBI:10432) is a naphthol (CHEBI:35682) |
| Incoming Relation(s) |
| 2-naphthyl butyrate (CHEBI:90150) has functional parent 2-naphthol (CHEBI:10432) |
| 2-naphthyl dihydrogen phosphate (CHEBI:91043) has functional parent 2-naphthol (CHEBI:10432) |
| 2-naphthyl octanoate (CHEBI:90250) has functional parent 2-naphthol (CHEBI:10432) |
| 2-naphthyl sulfate (CHEBI:167215) has functional parent 2-naphthol (CHEBI:10432) |
| 2-naphthyl tetradecanoate (CHEBI:90249) has functional parent 2-naphthol (CHEBI:10432) |
| 2-naphthyl α-D-glucoside (CHEBI:90256) has functional parent 2-naphthol (CHEBI:10432) |
| 2-naphthyl α-L-fucoside (CHEBI:90252) has functional parent 2-naphthol (CHEBI:10432) |
| 2-naphthyl β-D-galactoside (CHEBI:90140) has functional parent 2-naphthol (CHEBI:10432) |
| 2-naphthyl β-D-glucoside (CHEBI:90258) has functional parent 2-naphthol (CHEBI:10432) |
| 2-naphthyl β-L-fucoside (CHEBI:90254) has functional parent 2-naphthol (CHEBI:10432) |
| 4-amino-3-hydroxynaphthalene-1-sulfonic acid (CHEBI:19024) has functional parent 2-naphthol (CHEBI:10432) |
| 6-bromo-2-naphthol (CHEBI:34466) has functional parent 2-naphthol (CHEBI:10432) |
| Oil red O (CHEBI:88213) has functional parent 2-naphthol (CHEBI:10432) |
| Sudan I (CHEBI:30958) has functional parent 2-naphthol (CHEBI:10432) |
| Sudan III (CHEBI:82535) has functional parent 2-naphthol (CHEBI:10432) |
| Sudan IV (CHEBI:88014) has functional parent 2-naphthol (CHEBI:10432) |
| tolnaftate (CHEBI:9620) has functional parent 2-naphthol (CHEBI:10432) |
| β-naphthyl N-acetylphenylalaninate (CHEBI:7219) has functional parent 2-naphthol (CHEBI:10432) |
| IUPAC Name |
|---|
| naphthalen-2-ol |
| Synonyms | Source |
|---|---|
| beta-Naphthol | KEGG COMPOUND |
| β-hydroxynaphthalene | NIST Chemistry WebBook |
| 2-naphthalenol | NIST Chemistry WebBook |
| β-naphthol | NIST Chemistry WebBook |
| 2-Naphthol | KEGG COMPOUND |
| beta-Naphthol | KEGG COMPOUND |
| Brand Names | Source |
|---|---|
| Antioxygene BN | HMDB |
| Azogen Developer A | HMDB |
| Developer BN | ChemIDplus |
| C.I. Developer 5 | ChemIDplus |
| Developer AMS | ChemIDplus |
| Developer A | ChemIDplus |
| UniProt Name | Source |
|---|---|
| 2-naphthol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C11713 | KEGG COMPOUND |
| HMDB0012322 | HMDB |
| 2-Naphthol | Wikipedia |
| CPD-8131 | MetaCyc |
| 3370 | DrugCentral |
| 03V | PDBeChem |
| FDB000877 | FooDB |
| Citations |
|---|