EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H22O2 |
| Net Charge | 0 |
| Average Mass | 270.372 |
| Monoisotopic Mass | 270.16198 |
| SMILES | CCCCCCCC(=O)Oc1ccc2ccccc2c1 |
| InChI | InChI=1S/C18H22O2/c1-2-3-4-5-6-11-18(19)20-17-13-12-15-9-7-8-10-16(15)14-17/h7-10,12-14H,2-6,11H2,1H3 |
| InChIKey | CXVZBUOSDMLXNK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | chromogenic compound Colourless, endogenous or exogenous pigment precursors that may be transformed by biological mechanisms into coloured compounds. They are used in biochemical assays and in diagnosis as indicators, particularly in the form of enzyme substrates. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-naphthyl octanoate (CHEBI:90250) has functional parent 2-naphthol (CHEBI:10432) |
| 2-naphthyl octanoate (CHEBI:90250) has role chromogenic compound (CHEBI:75050) |
| 2-naphthyl octanoate (CHEBI:90250) is a aromatic ester (CHEBI:62732) |
| 2-naphthyl octanoate (CHEBI:90250) is a naphthalenes (CHEBI:25477) |
| 2-naphthyl octanoate (CHEBI:90250) is a octanoate ester (CHEBI:87657) |
| IUPAC Name |
|---|
| naphthalen-2-yl octanoate |
| Synonyms | Source |
|---|---|
| 2-Naphthyl caprylate | ChemIDplus |
| Octanoic acid, 2-naphthalenyl ester | ChemIDplus |
| Octanoic acid, 2-naphthyl ester | NIST Chemistry WebBook |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2531149 | Reaxys |
| CAS:10251-17-9 | ChemIDplus |
| CAS:10251-17-9 | NIST Chemistry WebBook |
| Citations |
|---|