EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H8O4S |
| Net Charge | 0 |
| Average Mass | 224.237 |
| Monoisotopic Mass | 224.01433 |
| SMILES | O=S(=O)(O)Oc1ccc2ccccc2c1 |
| InChI | InChI=1S/C10H8O4S/c11-15(12,13)14-10-6-5-8-3-1-2-4-9(8)7-10/h1-7H,(H,11,12,13) |
| InChIKey | HXEZIDSFDHEIIQ-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-naphthyl sulfate (CHEBI:167215) has functional parent 2-naphthol (CHEBI:10432) |
| 2-naphthyl sulfate (CHEBI:167215) is a aryl sulfate (CHEBI:37919) |
| 2-naphthyl sulfate (CHEBI:167215) is a naphthalenes (CHEBI:25477) |
| 2-naphthyl sulfate (CHEBI:167215) is conjugate acid of 2-naphthyl sulfate(1−) (CHEBI:167170) |
| Incoming Relation(s) |
| 2-naphthyl sulfate(1−) (CHEBI:167170) is conjugate base of 2-naphthyl sulfate (CHEBI:167215) |
| IUPAC Name |
|---|
| naphthalen-2-yl hydrogen sulfate |
| Synonyms | Source |
|---|---|
| 2-naphthalenol hydrogen sulfate | ChemIDplus |
| 2-naphthol sulfate | ChemIDplus |
| 2-naphthyl hydrogen sulfate | ChEBI |
| (naphthalen-2-yl)oxidanesulfonic acid | IUPAC |
| Manual Xrefs | Databases |
|---|---|
| 67020 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:13146-59-3 | ChemIDplus |
| Citations |
|---|