EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H17NOS |
| Net Charge | 0 |
| Average Mass | 307.418 |
| Monoisotopic Mass | 307.10309 |
| SMILES | Cc1cccc(N(C)C(=S)Oc2ccc3ccccc3c2)c1 |
| InChI | InChI=1S/C19H17NOS/c1-14-6-5-9-17(12-14)20(2)19(22)21-18-11-10-15-7-3-4-8-16(15)13-18/h3-13H,1-2H3 |
| InChIKey | FUSNMLFNXJSCDI-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. |
| Applications: | dermatologic drug A drug used to treat or prevent skin disorders or for the routine care of skin. antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tolnaftate (CHEBI:9620) has functional parent 2-naphthol (CHEBI:10432) |
| tolnaftate (CHEBI:9620) has role antifungal drug (CHEBI:86327) |
| tolnaftate (CHEBI:9620) has role antiinfective agent (CHEBI:35441) |
| tolnaftate (CHEBI:9620) has role dermatologic drug (CHEBI:50177) |
| tolnaftate (CHEBI:9620) is a monothiocarbamic ester (CHEBI:38128) |
| IUPAC Name |
|---|
| O-2-naphthyl methyl(3-methylphenyl)carbamothioate |
| INNs | Source |
|---|---|
| tolnaftate | WHO MedNet |
| tolnaftate | KEGG DRUG |
| tolnaftato | DrugBank |
| tolnaftatum | DrugBank |
| Synonyms | Source |
|---|---|
| 2-Naphthyl N-methyl-N-(3-tolyl)thionocarbamate | ChemIDplus |
| Methyl (3-methylphenyl)carbamothioic acid O-2-naphthalenyl ester | NIST Chemistry WebBook |
| m,N-Dimethylthiocarbanilic acid O-2-naphthyl ester | ChemIDplus |
| N-methyl-N-(3-methylphenyl)-1-(naphthalen-2-yloxy)methanethioamide | HMDB |
| NSC-233648 | ChEMBL |
| O-2-Naphthyl m,N-dimethylthiocarbanilate | ChemIDplus |
| Brand Names | Source |
|---|---|
| Mycil | ChEMBL |
| Separin | KEGG DRUG |
| Timoped | ChEMBL |
| Tinactin | KEGG DRUG |
| Tinaderm | ChEMBL |
| Tinaderm plus | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 3617 | DrugCentral |
| D00381 | KEGG DRUG |
| DB00525 | DrugBank |
| HMDB0005005 | HMDB |
| LSM-5554 | LINCS |
| Tolnaftate | Wikipedia |
| US2010035939 | Patent |
| WO2010037089 | Patent |
| Citations |
|---|