EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:9620 - tolnaftate
| Formula | C19H17NOS |
| Net Charge | 0 |
| Average Mass | 307.418 |
| Monoisotopic Mass | 307.10309 |
| SMILES | Cc1cccc(N(C)C(=S)Oc2ccc3ccccc3c2)c1 |
| InChI | InChI=1S/C19H17NOS/c1-14-6-5-9-17(12-14)20(2)19(22)21-18-11-10-15-7-3-4-8-16(15)13-18/h3-13H,1-2H3 |
| InChIKey | FUSNMLFNXJSCDI-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. |
| Application: | antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tolnaftate (CHEBI:9620) has functional parent 2-naphthol (CHEBI:10432) |
| tolnaftate (CHEBI:9620) has role antifungal drug (CHEBI:86327) |
| tolnaftate (CHEBI:9620) is a monothiocarbamic ester (CHEBI:38128) |
| IUPAC Name |
|---|
| O-2-naphthyl methyl(3-methylphenyl)carbamothioate |
| INNs | Source |
|---|---|
| tolnaftate | KEGG DRUG |
| tolnaftatum | DrugBank |
| tolnaftato | DrugBank |
| tolnaftate | WHO MedNet |
| Synonyms | Source |
|---|---|
| m,N-Dimethylthiocarbanilic acid O-2-naphthyl ester | ChemIDplus |
| 2-Naphthyl N-methyl-N-(3-tolyl)thionocarbamate | ChemIDplus |
| O-2-Naphthyl m,N-dimethylthiocarbanilate | ChemIDplus |
| N-methyl-N-(3-methylphenyl)-1-(naphthalen-2-yloxy)methanethioamide | HMDB |
| Tolnaphthate | NIST Chemistry WebBook |
| Methyl (3-methylphenyl)carbamothioic acid O-2-naphthalenyl ester | NIST Chemistry WebBook |
| Brand Names | Source |
|---|---|
| Separin | KEGG DRUG |
| Tinactin | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| D00381 | KEGG DRUG |
| DB00525 | DrugBank |
| HMDB0005005 | HMDB |
| Tolnaftate | Wikipedia |
| WO2010037089 | Patent |
| US2010035939 | Patent |
| LSM-5554 | LINCS |
| 3617 | DrugCentral |
| Citations |
|---|