EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:19024 - 4-amino-3-hydroxynaphthalene-1-sulfonic acid
| Formula | C10H9NO4S |
| Net Charge | 0 |
| Average Mass | 239.252 |
| Monoisotopic Mass | 239.02523 |
| SMILES | Nc1c(O)cc(S(=O)(=O)O)c2ccccc12 |
| InChI | InChI=1S/C10H9NO4S/c11-10-7-4-2-1-3-6(7)9(5-8(10)12)16(13,14)15/h1-5,12H,11H2,(H,13,14,15) |
| InChIKey | RXCMFQDTWCCLBL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | mutagen An agent that increases the frequency of mutations above the normal background level, usually by interacting directly with DNA and causing it damage, including base substitution. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-amino-3-hydroxynaphthalene-1-sulfonic acid (CHEBI:19024) has functional parent 2-naphthol (CHEBI:10432) |
| 4-amino-3-hydroxynaphthalene-1-sulfonic acid (CHEBI:19024) has role mutagen (CHEBI:25435) |
| 4-amino-3-hydroxynaphthalene-1-sulfonic acid (CHEBI:19024) is a aminonaphthalene (CHEBI:38034) |
| 4-amino-3-hydroxynaphthalene-1-sulfonic acid (CHEBI:19024) is a naphthalenesulfonic acid (CHEBI:36336) |
| IUPAC Name |
|---|
| 4-amino-3-hydroxynaphthalene-1-sulfonic acid |
| Synonyms | Source |
|---|---|
| 1-amino-2-naphthol-4-sulfonic acid | ChemIDplus |
| 1-amino-4-sulfo-2-naphthol | ChemIDplus |
| 4-amino-3-hydroxynaphthalene-1-sulphonic acid | ChemIDplus |