EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H24N4O |
| Net Charge | 0 |
| Average Mass | 408.505 |
| Monoisotopic Mass | 408.19501 |
| SMILES | Cc1ccc(C)c(N=Nc2cc(C)c(N=Nc3c(O)ccc4ccccc34)cc2C)c1 |
| InChI | InChI=1S/C26H24N4O/c1-16-9-10-17(2)22(13-16)27-28-23-14-19(4)24(15-18(23)3)29-30-26-21-8-6-5-7-20(21)11-12-25(26)31/h5-15,31H,1-4H3 |
| InChIKey | NPGIHFRTRXVWOY-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Application: | histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Oil red O (CHEBI:88213) has functional parent 2-naphthol (CHEBI:10432) |
| Oil red O (CHEBI:88213) has role histological dye (CHEBI:77178) |
| Oil red O (CHEBI:88213) is a azobenzenes (CHEBI:22682) |
| Oil red O (CHEBI:88213) is a bis(azo) compound (CHEBI:48960) |
| Oil red O (CHEBI:88213) is a naphthols (CHEBI:25392) |
| IUPAC Name |
|---|
| 1-({4-[(2,5-dimethylphenyl)diazenyl]-2,5-dimethylphenyl}diazenyl)naphthalen-2-ol |
| Synonyms | Source |
|---|---|
| Solvent red 27 | ChEBI |
| C.I. 26125 | ChEBI |
| 1-(2,5-Dimethyl-4-(2,5-dimethylphenylazo)phenylazo)-2-naphthol | ChemIDplus |
| Sudan Red 5B | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| Oil_Red_O | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:24002417 | Reaxys |
| CAS:14288-70-1 | ChemIDplus |
| Citations |
|---|