EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H16N4O |
| Net Charge | 0 |
| Average Mass | 352.397 |
| Monoisotopic Mass | 352.13241 |
| SMILES | Oc1ccc2ccccc2c1N=Nc1ccc(N=Nc2ccccc2)cc1 |
| InChI | InChI=1S/C22H16N4O/c27-21-15-10-16-6-4-5-9-20(16)22(21)26-25-19-13-11-18(12-14-19)24-23-17-7-2-1-3-8-17/h1-15,27H |
| InChIKey | FHNINJWBTRXEBC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. |
| Applications: | fluorochrome A fluorescent dye used to stain biological specimens. histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Sudan III (CHEBI:82535) has functional parent 2-naphthol (CHEBI:10432) |
| Sudan III (CHEBI:82535) has role carcinogenic agent (CHEBI:50903) |
| Sudan III (CHEBI:82535) has role fluorochrome (CHEBI:51217) |
| Sudan III (CHEBI:82535) has role histological dye (CHEBI:77178) |
| Sudan III (CHEBI:82535) is a azobenzenes (CHEBI:22682) |
| Sudan III (CHEBI:82535) is a bis(azo) compound (CHEBI:48960) |
| Sudan III (CHEBI:82535) is a naphthols (CHEBI:25392) |
| IUPAC Name |
|---|
| 1-{[4-(phenyldiazenyl)phenyl]diazenyl}naphthalen-2-ol |
| Synonyms | Source |
|---|---|
| 1-(4-(Phenylazo)phenylazo)-2-naphthol | ChemIDplus |
| Benzeneazobenzeneazo-beta-naphthol | ChemIDplus |
| C.I. 26100 | ChEBI |
| Solvent red 23 | ChEBI |
| Sudan 3 | ChemIDplus |
| Sudan red BK | ChEBI |
| Citations |
|---|