EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H34O2 |
| Net Charge | 0 |
| Average Mass | 354.534 |
| Monoisotopic Mass | 354.25588 |
| SMILES | CCCCCCCCCCCCCC(=O)Oc1ccc2ccccc2c1 |
| InChI | InChI=1S/C24H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-17-24(25)26-23-19-18-21-15-13-14-16-22(21)20-23/h13-16,18-20H,2-12,17H2,1H3 |
| InChIKey | SKRXBZIJSNMVFA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | chromogenic compound Colourless, endogenous or exogenous pigment precursors that may be transformed by biological mechanisms into coloured compounds. They are used in biochemical assays and in diagnosis as indicators, particularly in the form of enzyme substrates. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-naphthyl tetradecanoate (CHEBI:90249) has functional parent 2-naphthol (CHEBI:10432) |
| 2-naphthyl tetradecanoate (CHEBI:90249) has role chromogenic compound (CHEBI:75050) |
| 2-naphthyl tetradecanoate (CHEBI:90249) is a aromatic ester (CHEBI:62732) |
| 2-naphthyl tetradecanoate (CHEBI:90249) is a naphthalenes (CHEBI:25477) |
| 2-naphthyl tetradecanoate (CHEBI:90249) is a tetradecanoate ester (CHEBI:87691) |
| IUPAC Name |
|---|
| naphthalen-2-yl tetradecanoate |
| Synonyms | Source |
|---|---|
| 2-Naphthyl myristate | ChemIDplus |
| 2-Naphthylmyristate | ChemIDplus |
| NSC 122046 | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3376764 | Reaxys |
| CAS:7262-80-8 | ChemIDplus |