InChI=1S/C22H23ClN2O8/c1- 21(32) 7- 6- 8- 15(25(2) 3) 17(28) 13(20(24) 31) 19(30) 22(8,33) 18(29) 11(7) 16(27) 12- 10(26) 5- 4- 9(23) 14(12) 21/h4- 5,7- 8,15,26,28- 29,32- 33H,6H2,1- 3H3,(H2,24,31) /t7- ,8- ,15- ,21- ,22- /m0/s1 |
CYDMQBQPVICBEU-XRNKAMNCSA-N |
CN(C)[C@H]1[C@@H]2C[C@H]3C(=C(O)[C@]2(O)C(=O)C(C(N)=O)=C1O)C(=O)c1c(O)ccc(Cl)c1[C@@]3(C)O |
|
Streptomyces aureofaciens
(NCBI:txid1894)
|
See:
PubMed
|
Bronsted base
A molecular entity capable of accepting a hydron from a donor (Bronsted acid).
(via organic amino compound )
|
|
antiprotozoal drug
Any antimicrobial drug which is used to treat or prevent protozoal infections.
calcium ionophore
antibacterial drug
A drug used to treat or prevent bacterial infections.
metabolite
Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites.
(via tetracyclines )
|
|
antiprotozoal drug
Any antimicrobial drug which is used to treat or prevent protozoal infections.
fluorescent probe
A role played by a fluorescent molecular entity used to study the microscopic environment by fluorescence spectroscopy.
antibacterial drug
A drug used to treat or prevent bacterial infections.
|
|
(4S,4aS,5aS,6S,12aS)- 7- chloro- 4- (dimethylamino)- 3,6,10,12,12a- pentahydroxy- 6- methyl- 1,11- dioxo- 1,4,4a,5,5a,6,11,12a- octahydrotetracene- 2- carboxamide
|