InChI=1S/C30H50O3/c1- 21(11- 9- 12- 22(2) 15- 18- 27(32) 29(6,7) 33) 13- 10- 14- 24- 23(3) 16- 17- 25- 28(4,5) 26(31) 19- 20- 30(24,25) 8/h12- 13,16,24- 25,27,32- 33H,9- 11,14- 15,17- 20H2,1- 8H3/b21- 13+,22- 12+/t24- ,25- ,27+,30+/m0/s1 |
RYDUWPYFQUMUJP-JAKYJIPASA-N |
C\C(CC\C=C(/C)CC[C@@H](O)C(C)(C)O)=C/CC[C@H]1C(C)=CC[C@H]2C(C)(C)C(=O)CC[C@]12C |
|
Lansium domesticum
(NCBI:txid201017)
|
Found in
twig
(BTO:0001411).
95% ethanolic extract of air-dried and powdered twigs
See:
PubMed
|
metabolite
Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites.
antibacterial agent
A substance (or active part thereof) that kills or slows the growth of bacteria.
plant metabolite
Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms.
|
|
(4aR,5S,8aR)- 5- [(3E,7E,11R)- 11,12- dihydroxy- 4,8,12- trimethyltrideca- 3,7- dien- 1- yl]- 1,1,4a,6- tetramethyl- 3,4,4a,5,8,8a- hexahydronaphthalen- 2(1H)- one
|