InChI=1S/C43H54N2O10/c1- 8- 18- 34(46) 42(3,4) 37- 24- 14- 12- 10- 11- 13- 20- 29(50- 7) 26- 39- 45- 31(28- 52- 39) 41(49) 54- 36(19- 9- 2) 43(5,6) 35(47) 23- 17- 22- 33- 32(53- 33) 21- 15- 16- 25- 38- 44- 30(27- 51- 38) 40(48) 55- 37/h8- 22,25,27- 29,32- 37,46- 47H,23- 24,26H2,1- 7H3/b11- 10?,14- 12?,18- 8+,19- 9+,20- 13?,21- 15?,22- 17?,25- 16? |
XEVJRQFVFSNVAF-GIZBCDPESA-N |
O=C1OC(/C=C/C) C(C(O) CC=CC2OC2C=CC=CC=3OC=C(N3) C(OC(CC=CC=CC=CC(CC4=NC1=CO4) OC) C(C(O) /C=C/C) (C) C) =O) (C) C |
|
Bronsted acid
A molecular entity capable of donating a hydron to an acceptor (Bronsted base).
(via oxoacid )
|
|
12- hydroxy- 30- [(E)- 3- hydroxy- 2- methylhex- 4- en- 2- yl]- 22- methoxy- 13,13- dimethyl- 14- [(E)- prop- 1- enyl]- 7,15,19,31,35- pentaoxa- 36,37- diazatetracyclo[31.2.1.117,20.06,8]heptatriaconta- 1(36),2,4,9,17,20(37),23,25,27,33- decaene- 16,32- dione
|