|
8:2 fluorotelomer unsaturated carboxylic acid |
|
CHEBI:83495 |
|
A fluorotelomer that is dec-2-enoic acid substituted by fluoro groups at positions 3, 4, 4, 5, 5, 6, 6, 7, 7, 8, 8, 9, 9, 10, 10 and 10 respectively. |
|
![](images/goldenstar.gif) ![](images/goldenstar.gif)
This entity has been manually annotated by the ChEBI Team.
|
|
|
|
Molfile
XML
SDF
|
|
more structures >>
|
|
|
InChI=1S/C10H2F16O2/c11- 2(1- 3(27) 28) 4(12,13) 5(14,15) 6(16,17) 7(18,19) 8(20,21) 9(22,23) 10(24,25) 26/h1H,(H,27,28)![](images/invisible_space.gif) |
WHZXTVOEGZRRJM-UHFFFAOYSA-N |
OC(=O)C=C(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
|
persistent organic pollutant
Any environmental contaminant that is resistant to environmental degradation through photolytic, biological or chemical processes. Such substances can have significant impact on health and the environment, as they persist in the environment, bioaccumulate in animal tissue and so biomagnify in food chains.
Bronsted acid
A molecular entity capable of donating a hydron to an acceptor (Bronsted base).
(via oxoacid )
|
|
xenobiotic
A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means.
|
|
View more via ChEBI Ontology
3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-hexadecafluorodec-2-enoic acid
|
2192188
|
Reaxys Registry Number
|
Reaxys
|
|