EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:9300 - suberic acid
| Formula | C8H14O4 |
| Net Charge | 0 |
| Average Mass | 174.196 |
| Monoisotopic Mass | 174.08921 |
| SMILES | O=C(O)CCCCCCC(=O)O |
| InChI | InChI=1S/C8H14O4/c9-7(10)5-3-1-2-4-6-8(11)12/h1-6H2,(H,9,10)(H,11,12) |
| InChIKey | TYFQFVWCELRYAO-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| suberic acid (CHEBI:9300) has role human metabolite (CHEBI:77746) |
| suberic acid (CHEBI:9300) is a dicarboxylic fatty acid (CHEBI:189840) |
| suberic acid (CHEBI:9300) is a α,ω-dicarboxylic acid (CHEBI:28383) |
| suberic acid (CHEBI:9300) is conjugate acid of suberate (CHEBI:132953) |
| suberic acid (CHEBI:9300) is conjugate acid of suberate(2−) (CHEBI:76282) |
| Incoming Relation(s) |
| O-suberoylcarnitine (CHEBI:73052) has functional parent suberic acid (CHEBI:9300) |
| 2-ethyloctanedioic acid (CHEBI:68453) has functional parent suberic acid (CHEBI:9300) |
| 2-hydroxyoctanedioic acid (CHEBI:70767) has functional parent suberic acid (CHEBI:9300) |
| 2-oxosuberic acid (CHEBI:80587) has functional parent suberic acid (CHEBI:9300) |
| 3-hydroxysuberic acid (CHEBI:70766) has functional parent suberic acid (CHEBI:9300) |
| BML-210 (CHEBI:61077) has functional parent suberic acid (CHEBI:9300) |
| disuccinimidyl suberate (CHEBI:229718) has functional parent suberic acid (CHEBI:9300) |
| octanedioyl-CoA (CHEBI:76352) has functional parent suberic acid (CHEBI:9300) |
| vorinostat (CHEBI:45716) has functional parent suberic acid (CHEBI:9300) |
| suberate (CHEBI:132953) is conjugate base of suberic acid (CHEBI:9300) |
| suberate(2−) (CHEBI:76282) is conjugate base of suberic acid (CHEBI:9300) |
| IUPAC Name |
|---|
| octanedioic acid |
| Synonyms | Source |
|---|---|
| 1,6-dicarboxyhexane | NIST Chemistry WebBook |
| 1,6-Hexanedicarboxylic acid | KEGG COMPOUND |
| 1,8-Octanedioic acid | KEGG COMPOUND |
| Cork acid | KEGG COMPOUND |
| hexamethylenedicarboxylic acid | ChemIDplus |
| Korksäure | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00001204 | KNApSAcK |
| C08278 | KEGG COMPOUND |
| CPD0-1264 | MetaCyc |
| HMDB0000893 | HMDB |
| LMFA01170001 | LIPID MAPS |
| OCE | PDBeChem |
| Suberic_acid | Wikipedia |
| Citations |
|---|