EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H25N3O2 |
| Net Charge | 0 |
| Average Mass | 339.439 |
| Monoisotopic Mass | 339.19468 |
| SMILES | Nc1ccccc1NC(=O)CCCCCCC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C20H25N3O2/c21-17-12-8-9-13-18(17)23-20(25)15-7-2-1-6-14-19(24)22-16-10-4-3-5-11-16/h3-5,8-13H,1-2,6-7,14-15,21H2,(H,22,24)(H,23,25) |
| InChIKey | RFLHBLWLFUFFDZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 3.5.1.98 (histone deacetylase) inhibitor An EC 3.5.1.* (non-peptide linear amide C-N hydrolase) inhibitor that interferes with the function of histone deacetylase (EC 3.5.1.98). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| BML-210 (CHEBI:61077) has functional parent suberic acid (CHEBI:9300) |
| BML-210 (CHEBI:61077) has role antineoplastic agent (CHEBI:35610) |
| BML-210 (CHEBI:61077) has role EC 3.5.1.98 (histone deacetylase) inhibitor (CHEBI:61115) |
| BML-210 (CHEBI:61077) is a dicarboxylic acid diamide (CHEBI:35779) |
| IUPAC Name |
|---|
| N-(2-aminophenyl)-N'-phenyoctanediamide |
| Synonym | Source |
|---|---|
| N-(2-aminophenyl)-N'-phenyl-octanediamide | SUBMITTER |
| Manual Xrefs | Databases |
|---|---|
| LSM-37001 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9430672 | Reaxys |
| CAS:537034-17-6 | SUBMITTER |
| Citations |
|---|