EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H14O5 |
| Net Charge | 0 |
| Average Mass | 190.195 |
| Monoisotopic Mass | 190.08412 |
| SMILES | O=C(O)CCCCC(O)CC(=O)O |
| InChI | InChI=1S/C8H14O5/c9-6(5-8(12)13)3-1-2-4-7(10)11/h6,9H,1-5H2,(H,10,11)(H,12,13) |
| InChIKey | ARJZZFJXSNJKGR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-hydroxysuberic acid (CHEBI:70766) has functional parent suberic acid (CHEBI:9300) |
| 3-hydroxysuberic acid (CHEBI:70766) has role metabolite (CHEBI:25212) |
| 3-hydroxysuberic acid (CHEBI:70766) is a 3-hydroxy carboxylic acid (CHEBI:61355) |
| 3-hydroxysuberic acid (CHEBI:70766) is a dicarboxylic acid (CHEBI:35692) |
| IUPAC Name |
|---|
| 3-hydroxyoctanedioic acid |
| Manual Xrefs | Databases |
|---|---|
| HMDB0000325 | HMDB |
| LMFA01170093 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10665502 | Reaxys |
| Citations |
|---|