EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H20N2O3 |
| Net Charge | 0 |
| Average Mass | 264.325 |
| Monoisotopic Mass | 264.14739 |
| SMILES | O=C(CCCCCCC(=O)Nc1ccccc1)NO |
| InChI | InChI=1S/C14H20N2O3/c17-13(15-12-8-4-3-5-9-12)10-6-1-2-7-11-14(18)16-19/h3-5,8-9,19H,1-2,6-7,10-11H2,(H,15,17)(H,16,18) |
| InChIKey | WAEXFXRVDQXREF-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. EC 3.5.1.98 (histone deacetylase) inhibitor An EC 3.5.1.* (non-peptide linear amide C-N hydrolase) inhibitor that interferes with the function of histone deacetylase (EC 3.5.1.98). anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. anti-anaemic agent A compound which increases either the number of red cells or the amount of haemoglobin in the blood. antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vorinostat (CHEBI:45716) has functional parent aniline (CHEBI:17296) |
| vorinostat (CHEBI:45716) has functional parent hydroxylamine (CHEBI:15429) |
| vorinostat (CHEBI:45716) has functional parent suberic acid (CHEBI:9300) |
| vorinostat (CHEBI:45716) has role anti-anaemic agent (CHEBI:75835) |
| vorinostat (CHEBI:45716) has role anti-HIV agent (CHEBI:64946) |
| vorinostat (CHEBI:45716) has role antineoplastic agent (CHEBI:35610) |
| vorinostat (CHEBI:45716) has role antipsychotic agent (CHEBI:35476) |
| vorinostat (CHEBI:45716) has role apoptosis inducer (CHEBI:68495) |
| vorinostat (CHEBI:45716) has role EC 3.5.1.98 (histone deacetylase) inhibitor (CHEBI:61115) |
| vorinostat (CHEBI:45716) is a dicarboxylic acid diamide (CHEBI:35779) |
| vorinostat (CHEBI:45716) is a hydroxamic acid (CHEBI:24650) |
| IUPAC Name |
|---|
| N-hydroxy-N'-phenyloctanediamide |
| INNs | Source |
|---|---|
| vorinostat | WHO MedNet |
| vorinostat | WHO MedNet |
| vorinostat | ChemIDplus |
| vorinostatum | WHO MedNet |
| Synonyms | Source |
|---|---|
| MK-0683 | ChEMBL |
| MK0683 | ChEMBL |
| NSC-701852 | ChEMBL |
| NSC-748799 | ChEMBL |
| NSC-759852 | ChEMBL |
| octanedioic acid hydroxyamide phenylamide | ChEBI |
| Brand Name | Source |
|---|---|
| Zolinza | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| 4124 | DrugCentral |
| CN102641261 | Patent |
| D06320 | KEGG DRUG |
| DB02546 | DrugBank |
| HMDB0015568 | HMDB |
| KR20110045493 | Patent |
| LSM-3828 | LINCS |
| NZ592686 | Patent |
| SHH | PDBeChem |
| US2011039937 | Patent |
| Vorinostat | Wikipedia |
| WO2008106524 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7213017 | Reaxys |
| CAS:149647-78-9 | ChemIDplus |
| Citations |
|---|