EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H20N2O3 |
| Net Charge | 0 |
| Average Mass | 264.325 |
| Monoisotopic Mass | 264.14739 |
| SMILES | O=C(CCCCCCC(=O)Nc1ccccc1)NO |
| InChI | InChI=1S/C14H20N2O3/c17-13(15-12-8-4-3-5-9-12)10-6-1-2-7-11-14(18)16-19/h3-5,8-9,19H,1-2,6-7,10-11H2,(H,15,17)(H,16,18) |
| InChIKey | WAEXFXRVDQXREF-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. EC 3.5.1.98 (histone deacetylase) inhibitor An EC 3.5.1.* (non-peptide linear amide C-N hydrolase) inhibitor that interferes with the function of histone deacetylase (EC 3.5.1.98). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vorinostat (CHEBI:45716) has functional parent aniline (CHEBI:17296) |
| vorinostat (CHEBI:45716) has functional parent hydroxylamine (CHEBI:15429) |
| vorinostat (CHEBI:45716) has functional parent suberic acid (CHEBI:9300) |
| vorinostat (CHEBI:45716) has role antineoplastic agent (CHEBI:35610) |
| vorinostat (CHEBI:45716) has role apoptosis inducer (CHEBI:68495) |
| vorinostat (CHEBI:45716) has role EC 3.5.1.98 (histone deacetylase) inhibitor (CHEBI:61115) |
| vorinostat (CHEBI:45716) is a dicarboxylic acid diamide (CHEBI:35779) |
| vorinostat (CHEBI:45716) is a hydroxamic acid (CHEBI:24650) |
| IUPAC Name |
|---|
| N-hydroxy-N'-phenyloctanediamide |
| INNs | Source |
|---|---|
| vorinostat | ChemIDplus |
| vorinostat | WHO MedNet |
| vorinostat | WHO MedNet |
| vorinostatum | WHO MedNet |
| Synonyms | Source |
|---|---|
| octanedioic acid hydroxyamide phenylamide | ChEBI |
| SAHA | HMDB |
| SHH | HMDB |
| Suberanilohydroxamic acid | HMDB |
| suberoylanilide hydroxamic acid | ChEBI |
| Brand Name | Source |
|---|---|
| Zolinza | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| 4124 | DrugCentral |
| CN102641261 | Patent |
| D06320 | KEGG DRUG |
| DB02546 | DrugBank |
| HMDB0015568 | HMDB |
| KR20110045493 | Patent |
| LSM-3828 | LINCS |
| NZ592686 | Patent |
| SHH | PDBeChem |
| US2011039937 | Patent |
| Vorinostat | Wikipedia |
| WO2008106524 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7213017 | Reaxys |
| CAS:149647-78-9 | ChemIDplus |
| Citations |
|---|