EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H18O4 |
| Net Charge | 0 |
| Average Mass | 202.250 |
| Monoisotopic Mass | 202.12051 |
| SMILES | CCC(CCCCCC(=O)O)C(=O)O |
| InChI | InChI=1S/C10H18O4/c1-2-8(10(13)14)6-4-3-5-7-9(11)12/h8H,2-7H2,1H3,(H,11,12)(H,13,14) |
| InChIKey | WUDDSDIHJHPJRP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-ethyloctanedioic acid (CHEBI:68453) has functional parent suberic acid (CHEBI:9300) |
| 2-ethyloctanedioic acid (CHEBI:68453) has role metabolite (CHEBI:25212) |
| 2-ethyloctanedioic acid (CHEBI:68453) is a α,ω-dicarboxylic acid (CHEBI:28383) |
| IUPAC Name |
|---|
| 2-ethyloctanedioic acid |
| Synonym | Source |
|---|---|
| 2-ethylsuberic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1778835 | Reaxys |
| CAS:3971-33-3 | ChemIDplus |
| Citations |
|---|