EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H20N2O8 |
| Net Charge | 0 |
| Average Mass | 368.342 |
| Monoisotopic Mass | 368.12197 |
| SMILES | O=C(CCCCCCC(=O)ON1C(=O)CCC1=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C16H20N2O8/c19-11-7-8-12(20)17(11)25-15(23)5-3-1-2-4-6-16(24)26-18-13(21)9-10-14(18)22/h1-10H2 |
| InChIKey | ZWIBGKZDAWNIFC-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Application: | cross-linking reagent A reagent with two reactive groups, usually at opposite ends of the molecule, that are capable of reacting with and thereby forming bridges between macromolecules, principally side chains of amino acids in proteins, allowing the locations of naturally reactive areas within the proteins to be identified. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| disuccinimidyl suberate (CHEBI:229718) has functional parent suberic acid (CHEBI:9300) |
| disuccinimidyl suberate (CHEBI:229718) has role cross-linking reagent (CHEBI:50684) |
| disuccinimidyl suberate (CHEBI:229718) is a N-hydroxysuccinimide ester (CHEBI:53165) |
| disuccinimidyl suberate (CHEBI:229718) is a diester (CHEBI:51307) |
| IUPAC Name |
|---|
| 1,1'-[(1,8-dioxooctane-1,8-diyl)bis(oxy)]dipyrrolidine-2,5-dione |
| Synonyms | Source |
|---|---|
| 1,1'-[(1,8-dioxooctane-1,8-diyl)bis(oxy)]di(pyrrolidine-2,5-dione) | IUPAC |
| DSS | ChEBI |
| octanedioic acid di-N-hydroxysuccinimide ester | ChEBI |
| suberic acid bis(N-hydroxy succinimide ester) | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| Disuccinimidyl_suberate | Wikipedia |
| HMDB0251485 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:68528-80-3 | SUBMITTER |
| Citations |
|---|