EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H12O5 |
| Net Charge | 0 |
| Average Mass | 188.179 |
| Monoisotopic Mass | 188.06847 |
| SMILES | O=C(O)CCCCCC(=O)C(=O)O |
| InChI | InChI=1S/C8H12O5/c9-6(8(12)13)4-2-1-3-5-7(10)11/h1-5H2,(H,10,11)(H,12,13) |
| InChIKey | HAGOOZVJLSSXGZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-oxosuberic acid (CHEBI:80587) has functional parent suberic acid (CHEBI:9300) |
| 2-oxosuberic acid (CHEBI:80587) is a oxo dicarboxylic acid (CHEBI:36145) |
| 2-oxosuberic acid (CHEBI:80587) is conjugate acid of 2-oxosuberate(2−) (CHEBI:177882) |
| Incoming Relation(s) |
| 2-oxosuberate(2−) (CHEBI:177882) is conjugate base of 2-oxosuberic acid (CHEBI:80587) |
| IUPAC Name |
|---|
| 2-oxooctanedioic acid |
| Synonyms | Source |
|---|---|
| α-ketosuberic acid | ChemIDplus |
| 2-ketosuberic acid | ChEBI |
| 2-oxosuberic acid | ChEBI |
| α-oxosuberic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1778635 | Reaxys |
| CAS:96406-05-2 | ChemIDplus |
| Citations |
|---|