EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:84410 - sphingoid base(1+)
| Formula | C3H9NO2R |
| Net Charge | +1 |
| Average Mass (excl. R groups) | 91.109 |
| Monoisotopic Mass (excl. R groups) | 91.06333 |
| SMILES | *[C@@H](O)[C@@H]([NH3+])CO |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sphingoid base(1+) (CHEBI:84410) is a cationic sphingoid (CHEBI:83876) |
| sphingoid base(1+) (CHEBI:84410) is a sphingoid (CHEBI:35785) |
| Incoming Relation(s) |
| (4R)-hydroxysphing-(8Z)-enine(1+) (CHEBI:157607) is a sphingoid base(1+) (CHEBI:84410) |
| N-(1,2-saturated very-long-chain fatty acyl)-(R)-4-hydroxysphingoid base (CHEBI:155887) is a sphingoid base(1+) (CHEBI:84410) |
| N-(2-hydroxy-very-long-chain fatty acyl)-(R)-4-hydroxysphingoid base (CHEBI:155929) is a sphingoid base(1+) (CHEBI:84410) |
| N,N-dimethylsphingosine(1+) (CHEBI:189587) is a sphingoid base(1+) (CHEBI:84410) |
| 14-methylhexadecasphingosine(1+) (CHEBI:83260) is a sphingoid base(1+) (CHEBI:84410) |
| 15-methylhexadecasphing-4-enine(1+) (CHEBI:70771) is a sphingoid base(1+) (CHEBI:84410) |
| 15-methylhexadecasphinganine(1+) (CHEBI:70829) is a sphingoid base(1+) (CHEBI:84410) |
| 4-hydroxy-15-methylhexadecasphinganine(1+) (CHEBI:70983) is a sphingoid base(1+) (CHEBI:84410) |
| 4-hydroxysphing-8-enine(1+) (CHEBI:83175) is a sphingoid base(1+) (CHEBI:84410) |
| 6-hydroxysphingosine(1+) (CHEBI:195284) is a sphingoid base(1+) (CHEBI:84410) |
| C16 phytosphingosine(1+) (CHEBI:76699) is a sphingoid base(1+) (CHEBI:84410) |
| C17 sphingosine(1+) (CHEBI:74166) is a sphingoid base(1+) (CHEBI:84410) |
| C20 phytosphingosine(1+) (CHEBI:64885) is a sphingoid base(1+) (CHEBI:84410) |
| C20 sphinganine(1+) (CHEBI:64887) is a sphingoid base(1+) (CHEBI:84410) |
| C20 sphingosine(1+) (CHEBI:71983) is a sphingoid base(1+) (CHEBI:84410) |
| hexadecasphing-4-enine(1+) (CHEBI:71011) is a sphingoid base(1+) (CHEBI:84410) |
| hexadecasphinganine(1+) (CHEBI:71009) is a sphingoid base(1+) (CHEBI:84410) |
| phytosphingosine(1+) (CHEBI:64124) is a sphingoid base(1+) (CHEBI:84410) |
| sphinga-(4E,8Z)-dienine(1+) (CHEBI:157606) is a sphingoid base(1+) (CHEBI:84410) |
| sphinga-4E,14Z-dienine(1+) (CHEBI:83568) is a sphingoid base(1+) (CHEBI:84410) |
| sphinga-4E,8E-dienine(1+) (CHEBI:72758) is a sphingoid base(1+) (CHEBI:84410) |
| sphinganine(1+) (CHEBI:57817) is a sphingoid base(1+) (CHEBI:84410) |
| sphingosine(1+) (CHEBI:57756) is a sphingoid base(1+) (CHEBI:84410) |
| tetradecaphytosphingosine(1+) (CHEBI:82879) is a sphingoid base(1+) (CHEBI:84410) |
| tetradecasphinganine(1+) (CHEBI:71010) is a sphingoid base(1+) (CHEBI:84410) |
| tetradecasphingosine(1+) (CHEBI:82878) is a sphingoid base(1+) (CHEBI:84410) |
| Synonym | Source |
|---|---|
| 2-amino-1,3-dihydroxysphingoid base(1+) | ChEBI |
| UniProt Name | Source |
|---|---|
| a sphingoid base | UniProt |