EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H40NO2 |
| Net Charge | +1 |
| Average Mass | 302.523 |
| Monoisotopic Mass | 302.30536 |
| SMILES | CCCCCCCCCCCCCCC[C@@H](O)[C@@H]([NH3+])CO |
| InChI | InChI=1S/C18H39NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-18(21)17(19)16-20/h17-18,20-21H,2-16,19H2,1H3/p+1/t17-,18+/m0/s1 |
| InChIKey | OTKJDMGTUTTYMP-ZWKOTPCHSA-O |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sphinganine(1+) (CHEBI:57817) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| sphinganine(1+) (CHEBI:57817) has role human metabolite (CHEBI:77746) |
| sphinganine(1+) (CHEBI:57817) is a sphingoid base(1+) (CHEBI:84410) |
| sphinganine(1+) (CHEBI:57817) is conjugate acid of sphinganine (CHEBI:16566) |
| Incoming Relation(s) |
| N-acetyl-β-D-glucosaminyl-(1→3)-β-D-galactosyl-(1→4)-β-D-glucosyl-(1↔1')-ceramide(d18:0) (CHEBI:144629) has functional parent sphinganine(1+) (CHEBI:57817) |
| sphinganine (CHEBI:16566) is conjugate base of sphinganine(1+) (CHEBI:57817) |
| IUPAC Name |
|---|
| (2S,3R)-1,3-dihydroxyoctadecan-2-aminium |
| Synonyms | Source |
|---|---|
| C18-sphinganine | ChEBI |
| C18-sphinganine(1+) | ChEBI |
| d18:0(1+) | ChEBI |
| UniProt Name | Source |
|---|---|
| sphinganine | UniProt |