EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H36NO2 |
| Net Charge | +1 |
| Average Mass | 286.480 |
| Monoisotopic Mass | 286.27406 |
| SMILES | CC(C)CCCCCCCCC/C=C/[C@@H](O)[C@@H]([NH3+])CO |
| InChI | InChI=1S/C17H35NO2/c1-15(2)12-10-8-6-4-3-5-7-9-11-13-17(20)16(18)14-19/h11,13,15-17,19-20H,3-10,12,14,18H2,1-2H3/p+1/b13-11+/t16-,17+/m0/s1 |
| InChIKey | LZKPPSAEINBHRP-KORIGIIASA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 15-methylhexadecasphing-4-enine(1+) (CHEBI:70771) is a sphingoid base(1+) (CHEBI:84410) |
| 15-methylhexadecasphing-4-enine(1+) (CHEBI:70771) is conjugate acid of 15-methylhexadecasphing-4-enine (CHEBI:70798) |
| Incoming Relation(s) |
| 15-methylhexadecasphing-4-enine (CHEBI:70798) is conjugate base of 15-methylhexadecasphing-4-enine(1+) (CHEBI:70771) |
| IUPAC Name |
|---|
| (2S,3R,4E)-1,3-dihydroxy-15-methylhexadec-4-en-2-aminium |
| Synonyms | Source |
|---|---|
| 15-methyl-2-aminohexadec-4-en-1,3-diol | SUBMITTER |
| 15-methylhexadecasphing-4E-enine | LIPID MAPS |
| 15-methyl-hexadecasphingosine | LIPID MAPS |
| C17 isosphingosine | ChEBI |
| iso (4E,15-methyl-d16:1) sphingosine | LIPID MAPS |
| UniProt Name | Source |
|---|---|
| 15-methylhexadecasphing-4-enine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| LMSP01080005 | LIPID MAPS |
| Citations |
|---|