EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H38NO2 |
| Net Charge | +1 |
| Average Mass | 300.507 |
| Monoisotopic Mass | 300.28971 |
| SMILES | CCCCCCCCCCCCC/C=C/[C@@H](O)[C@@H]([NH3+])CO |
| InChI | InChI=1S/C18H37NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-18(21)17(19)16-20/h14-15,17-18,20-21H,2-13,16,19H2,1H3/p+1/b15-14+/t17-,18+/m0/s1 |
| InChIKey | WWUZIQQURGPMPG-KRWOKUGFSA-O |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sphingosine(1+) (CHEBI:57756) has role human metabolite (CHEBI:77746) |
| sphingosine(1+) (CHEBI:57756) is a sphingoid base(1+) (CHEBI:84410) |
| sphingosine(1+) (CHEBI:57756) is conjugate acid of sphingosine (CHEBI:16393) |
| sphingosine(1+) (CHEBI:57756) is enantiomer of L-erythro-sphingosine(1+) (CHEBI:77956) |
| Incoming Relation(s) |
| N,N-dimethylsphingosine(1+) (CHEBI:189587) has functional parent sphingosine(1+) (CHEBI:57756) |
| sphingosine (CHEBI:16393) is conjugate base of sphingosine(1+) (CHEBI:57756) |
| L-erythro-sphingosine(1+) (CHEBI:77956) is enantiomer of sphingosine(1+) (CHEBI:57756) |
| IUPAC Name |
|---|
| (2S,3R,4E)-1,3-dihydroxyoctadec-4-en-2-aminium |
| UniProt Name | Source |
|---|---|
| sphing-4-enine | UniProt |