EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H38NO3 |
| Net Charge | +1 |
| Average Mass | 304.495 |
| Monoisotopic Mass | 304.28462 |
| SMILES | CC(C)CCCCCCCCCC[C@@H](O)[C@@H](O)[C@@H]([NH3+])CO |
| InChI | InChI=1S/C17H37NO3/c1-14(2)11-9-7-5-3-4-6-8-10-12-16(20)17(21)15(18)13-19/h14-17,19-21H,3-13,18H2,1-2H3/p+1/t15-,16+,17-/m0/s1 |
| InChIKey | LKHKEQFLKWCGTG-BBWFWOEESA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-hydroxy-15-methylhexadecasphinganine(1+) (CHEBI:70983) is a sphingoid base(1+) (CHEBI:84410) |
| 4-hydroxy-15-methylhexadecasphinganine(1+) (CHEBI:70983) is conjugate acid of 15-methylhexadecaphytosphingosine (CHEBI:70968) |
| Incoming Relation(s) |
| 15-methylhexadecaphytosphingosine (CHEBI:70968) is conjugate base of 4-hydroxy-15-methylhexadecasphinganine(1+) (CHEBI:70983) |
| IUPAC Name |
|---|
| (2S,3S,4R)-1,3,4-trihydroxy-15-methylhexadecan-2-aminium |
| Synonyms | Source |
|---|---|
| 4-hydroxy-15-methylhexadecasphinganine cation | ChEBI |
| 15-methylhexadecaphytosphingosine cation | ChEBI |
| 15-methylhexadecaphytosphingosine(1+) | ChEBI |