EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H36NO2 |
| Net Charge | +1 |
| Average Mass | 286.480 |
| Monoisotopic Mass | 286.27406 |
| SMILES | CCCCCCCCCCCC/C=C/[C@@H](O)[C@@H]([NH3+])CO |
| InChI | InChI=1S/C17H35NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-17(20)16(18)15-19/h13-14,16-17,19-20H,2-12,15,18H2,1H3/p+1/b14-13+/t16-,17+/m0/s1 |
| InChIKey | RBEJCQPPFCKTRZ-LHMZYYNSSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| C17 sphingosine(1+) (CHEBI:74166) is a sphingoid base(1+) (CHEBI:84410) |
| C17 sphingosine(1+) (CHEBI:74166) is conjugate acid of C17 sphingosine (CHEBI:74220) |
| Incoming Relation(s) |
| N-octadecanoyl-C17-sphingosine (CHEBI:172405) has functional parent C17 sphingosine(1+) (CHEBI:74166) |
| N-tetracosanoyl-C17-sphingosine (CHEBI:74167) has functional parent C17 sphingosine(1+) (CHEBI:74166) |
| N-tetracosenoyl-C17-sphingosine (CHEBI:74185) has functional parent C17 sphingosine(1+) (CHEBI:74166) |
| C17 sphingosine (CHEBI:74220) is conjugate base of C17 sphingosine(1+) (CHEBI:74166) |
| IUPAC Name |
|---|
| (2S,3R,4E)-1,3-dihydroxyheptadec-4-en-2-aminium |
| Synonym | Source |
|---|---|
| heptadecasphing-4-enine | SUBMITTER |
| UniProt Name | Source |
|---|---|
| heptadecasphing-4-enine | UniProt |