EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H44NO2 |
| Net Charge | +1 |
| Average Mass | 330.577 |
| Monoisotopic Mass | 330.33666 |
| SMILES | CCCCCCCCCCCCCCCCC[C@@H](O)[C@@H]([NH3+])CO |
| InChI | InChI=1S/C20H43NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20(23)19(21)18-22/h19-20,22-23H,2-18,21H2,1H3/p+1/t19-,20+/m0/s1 |
| InChIKey | UFMHYBVQZSPWSS-VQTJNVASSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| C20 sphinganine(1+) (CHEBI:64887) is a sphingoid base(1+) (CHEBI:84410) |
| C20 sphinganine(1+) (CHEBI:64887) is conjugate acid of C20 sphinganine (CHEBI:64905) |
| Incoming Relation(s) |
| C20 sphinganine (CHEBI:64905) is conjugate base of C20 sphinganine(1+) (CHEBI:64887) |
| IUPAC Name |
|---|
| (2S,3R)-1,3-dihydroxyicosan-2-aminium |
| Synonyms | Source |
|---|---|
| C20 sphinganinium cation | ChEBI |
| C20 sphinganinium | ChEBI |
| eicosadihydrosphingosine(1+) | ChEBI |
| eicosasphinganine(1+) | ChEBI |
| icosasphinganine(1+) | ChEBI |
| icosadihydrosphingosine(1+) | ChEBI |
| UniProt Name | Source |
|---|---|
| C20 sphinganine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-13611 | MetaCyc |
| Citations |
|---|