EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H11NO4 |
| Net Charge | 0 |
| Average Mass | 197.190 |
| Monoisotopic Mass | 197.06881 |
| SMILES | N[C@@H](Cc1ccc(O)c(O)c1)C(=O)O |
| InChI | InChI=1S/C9H11NO4/c10-6(9(13)14)3-5-1-2-7(11)8(12)4-5/h1-2,4,6,11-12H,3,10H2,(H,13,14)/t6-/m0/s1 |
| InChIKey | WTDRDQBEARUVNC-LURJTMIESA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | allelochemical A class of secondary metabolites developed by many plants to influence the behaviour, growth or survival of herbivores, and thus acting as a defence against herbivory. neurotoxin A poison that interferes with the functions of the nervous system. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). dopaminergic agent A drug used for its effects on dopamine receptors, on the life cycle of dopamine, or on the survival of dopaminergic neurons. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| Applications: | antiparkinson drug A drug used in the treatment of Parkinson's disease. prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. antidyskinesia agent Any compound which can be used to treat or alleviate the symptoms of dyskinesia. dopaminergic agent A drug used for its effects on dopamine receptors, on the life cycle of dopamine, or on the survival of dopaminergic neurons. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-dopa (CHEBI:15765) has role allelochemical (CHEBI:62215) |
| L-dopa (CHEBI:15765) has role antidyskinesia agent (CHEBI:66956) |
| L-dopa (CHEBI:15765) has role antiparkinson drug (CHEBI:48407) |
| L-dopa (CHEBI:15765) has role dopaminergic agent (CHEBI:48560) |
| L-dopa (CHEBI:15765) has role hapten (CHEBI:59174) |
| L-dopa (CHEBI:15765) has role human metabolite (CHEBI:77746) |
| L-dopa (CHEBI:15765) has role mouse metabolite (CHEBI:75771) |
| L-dopa (CHEBI:15765) has role neurotoxin (CHEBI:50910) |
| L-dopa (CHEBI:15765) has role plant growth retardant (CHEBI:35219) |
| L-dopa (CHEBI:15765) has role plant metabolite (CHEBI:76924) |
| L-dopa (CHEBI:15765) has role prodrug (CHEBI:50266) |
| L-dopa (CHEBI:15765) is a L-tyrosine derivative (CHEBI:27177) |
| L-dopa (CHEBI:15765) is a dopa (CHEBI:49168) |
| L-dopa (CHEBI:15765) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| L-dopa (CHEBI:15765) is conjugate acid of L-dopa(1−) (CHEBI:67012) |
| L-dopa (CHEBI:15765) is enantiomer of D-dopa (CHEBI:49169) |
| L-dopa (CHEBI:15765) is tautomer of L-dopa zwitterion (CHEBI:57504) |
| Incoming Relation(s) |
| N-methyl-L-dopa (CHEBI:167646) has functional parent L-dopa (CHEBI:15765) |
| 2-S-cysteinyl-DOPA (CHEBI:84296) has functional parent L-dopa (CHEBI:15765) |
| 2,5-S,S'-dicysteinyldopa (CHEBI:84298) has functional parent L-dopa (CHEBI:15765) |
| 3-O-methyldopa (CHEBI:82913) has functional parent L-dopa (CHEBI:15765) |
| 3,4-dimethoxy-L-phenylalanine (CHEBI:229731) has functional parent L-dopa (CHEBI:15765) |
| 4-O-methyl-L-dopa (CHEBI:193023) has functional parent L-dopa (CHEBI:15765) |
| 6-fluoro-L-dopa (CHEBI:49163) has functional parent L-dopa (CHEBI:15765) |
| 6-hydroxy-L-dopa (CHEBI:72753) has functional parent L-dopa (CHEBI:15765) |
| foslevodopa (CHEBI:192509) has functional parent L-dopa (CHEBI:15765) |
| L-dopa(1−) (CHEBI:67012) is conjugate base of L-dopa (CHEBI:15765) |
| D-dopa (CHEBI:49169) is enantiomer of L-dopa (CHEBI:15765) |
| L-dopa zwitterion (CHEBI:57504) is tautomer of L-dopa (CHEBI:15765) |
| IUPAC Names |
|---|
| (2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoic acid |
| L-dopa |
| INNs | Source |
|---|---|
| levodopa | KEGG DRUG |
| levodopum | ChemIDplus |
| Synonyms | Source |
|---|---|
| (−)-3-(3,4-dihydroxyphenyl)-L-alanine | ChemIDplus |
| 3,4-Dihydroxy-L-phenylalanine | KEGG COMPOUND |
| 3,4-DIHYDROXYPHENYLALANINE | PDBeChem |
| 3-Hydroxy-L-tyrosine | KEGG COMPOUND |
| Dihydroxy-L-phenylalanine | KEGG COMPOUND |
| (−)-dopa | ChemIDplus |
| Brand Name | Source |
|---|---|
| Dopar | KEGG DRUG |
| Citations |
|---|