EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H11NO5 |
| Net Charge | 0 |
| Average Mass | 213.189 |
| Monoisotopic Mass | 213.06372 |
| SMILES | N[C@@H](Cc1cc(O)c(O)cc1O)C(=O)O |
| InChI | InChI=1S/C9H11NO5/c10-5(9(14)15)1-4-2-7(12)8(13)3-6(4)11/h2-3,5,11-13H,1,10H2,(H,14,15)/t5-/m0/s1 |
| InChIKey | YLKRUSPZOTYMAT-YFKPBYRVSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-hydroxy-L-dopa (CHEBI:72753) has functional parent L-dopa (CHEBI:15765) |
| 6-hydroxy-L-dopa (CHEBI:72753) is a L-phenylalanine derivative (CHEBI:84144) |
| 6-hydroxy-L-dopa (CHEBI:72753) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| IUPAC Name |
|---|
| 2,5-dihydroxy-L-tyrosine |
| Synonyms | Source |
|---|---|
| 2,4,5-trihydroxyphenyl-L-alanine | ChEBI |
| 2,4,5-trihydroxy-L-phenylalanine | ChEBI |
| 6-Hydroxydopa | ChemIDplus |
| 6-OH-DOPA | ChemIDplus |
| L-2,4,5-Trihydroxyphenylalanine | ChemIDplus |
| L-6-Hydroxydopa | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4468545 | Reaxys |
| CAS:27244-64-0 | ChemIDplus |
| Citations |
|---|