EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H21N3O8S2 |
| Net Charge | 0 |
| Average Mass | 435.480 |
| Monoisotopic Mass | 435.07701 |
| SMILES | N[C@@H](CSc1cc(C[C@H](N)C(=O)O)c(SC[C@H](N)C(=O)O)c(O)c1O)C(=O)O |
| InChI | InChI=1S/C15H21N3O8S2/c16-6(13(21)22)1-5-2-9(27-3-7(17)14(23)24)10(19)11(20)12(5)28-4-8(18)15(25)26/h2,6-8,19-20H,1,3-4,16-18H2,(H,21,22)(H,23,24)(H,25,26)/t6-,7-,8-/m0/s1 |
| InChIKey | PYGLBYQINHTALU-FXQIFTODSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (891724) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,5-S,S'-dicysteinyldopa (CHEBI:84298) has functional parent L-dopa (CHEBI:15765) |
| 2,5-S,S'-dicysteinyldopa (CHEBI:84298) has role human urinary metabolite (CHEBI:84087) |
| 2,5-S,S'-dicysteinyldopa (CHEBI:84298) is a S-conjugate (CHEBI:64987) |
| 2,5-S,S'-dicysteinyldopa (CHEBI:84298) is a S-organyl-L-cysteine (CHEBI:47912) |
| 2,5-S,S'-dicysteinyldopa (CHEBI:84298) is a L-tyrosine derivative (CHEBI:27177) |
| 2,5-S,S'-dicysteinyldopa (CHEBI:84298) is a aryl sulfide (CHEBI:35683) |
| 2,5-S,S'-dicysteinyldopa (CHEBI:84298) is a catechols (CHEBI:33566) |
| 2,5-S,S'-dicysteinyldopa (CHEBI:84298) is a triamine (CHEBI:38751) |
| 2,5-S,S'-dicysteinyldopa (CHEBI:84298) is a tricarboxylic acid (CHEBI:27093) |
| IUPAC Name |
|---|
| 2,5-bis{[(2R)-2-amino-2-carboxyethyl]sulfanyl}-3-hydroxy-L-tyrosine |
| Synonyms | Source |
|---|---|
| 2,5-S,S-dicysteinyl-3,4-dihydroxyphenylalanine | ChEBI |
| 2,5-S,S-Dicysteinyldopa | ChemIDplus |
| 3-(2,5-S,S-dicysteinyl-3,4-dihydroxyphenyl)alanine | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5182705 | Reaxys |
| CAS:57954-84-4 | ChemIDplus |
| Citations |
|---|