EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:49169 - D-dopa
| Formula | C9H11NO4 |
| Net Charge | 0 |
| Average Mass | 197.190 |
| Monoisotopic Mass | 197.06881 |
| SMILES | N[C@H](Cc1ccc(O)c(O)c1)C(=O)O |
| InChI | InChI=1S/C9H11NO4/c10-6(9(13)14)3-5-1-2-7(11)8(12)4-5/h1-2,4,6,11-12H,3,10H2,(H,13,14)/t6-/m1/s1 |
| InChIKey | WTDRDQBEARUVNC-ZCFIWIBFSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-dopa (CHEBI:49169) is a D-tyrosine derivative (CHEBI:84124) |
| D-dopa (CHEBI:49169) is a dopa (CHEBI:49168) |
| D-dopa (CHEBI:49169) is enantiomer of L-dopa (CHEBI:15765) |
| D-dopa (CHEBI:49169) is tautomer of D-dopa zwitterion (CHEBI:149689) |
| Incoming Relation(s) |
| N-methyl-D-dopa (CHEBI:167647) has functional parent D-dopa (CHEBI:49169) |
| L-dopa (CHEBI:15765) is enantiomer of D-dopa (CHEBI:49169) |
| D-dopa zwitterion (CHEBI:149689) is tautomer of D-dopa (CHEBI:49169) |
| IUPAC Names |
|---|
| (2R)-2-amino-3-(3,4-dihydroxyphenyl)propanoic acid |
| D-dopa |
| Synonyms | Source |
|---|---|
| (+)-3-(3,4-dihydroxyphenyl)alanine | ChemIDplus |
| (+)-3,4-dihydroxyphenylalanine | ChemIDplus |
| 3,4-dihydroxy-D-phenylalanine | ChemIDplus |
| 3-hydroxy-D-tyrosine | ChemIDplus |
| dopa D-form | ChemIDplus |
| D-3-(3,4-dihydroxyphenyl)alanine | ChemIDplus |
| Citations |
|---|