EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H15NO4 |
| Net Charge | 0 |
| Average Mass | 225.244 |
| Monoisotopic Mass | 225.10011 |
| SMILES | COc1ccc(C[C@H](N)C(=O)O)cc1OC |
| InChI | InChI=1S/C11H15NO4/c1-15-9-4-3-7(6-10(9)16-2)5-8(12)11(13)14/h3-4,6,8H,5,12H2,1-2H3,(H,13,14)/t8-/m0/s1 |
| InChIKey | VWTFNYVAFGYEKI-QMMMGPOBSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,4-dimethoxy-L-phenylalanine (CHEBI:229731) has functional parent L-dopa (CHEBI:15765) |
| 3,4-dimethoxy-L-phenylalanine (CHEBI:229731) is a L-tyrosine derivative (CHEBI:27177) |
| 3,4-dimethoxy-L-phenylalanine (CHEBI:229731) is a dimethoxybenzene (CHEBI:51681) |
| 3,4-dimethoxy-L-phenylalanine (CHEBI:229731) is tautomer of 3,4-dimethoxy-L-phenylalanine zwitterion (CHEBI:229727) |
| Incoming Relation(s) |
| 3,4-dimethoxy-L-phenylalanine zwitterion (CHEBI:229727) is tautomer of 3,4-dimethoxy-L-phenylalanine (CHEBI:229731) |
| IUPAC Name |
|---|
| 3-methoxy-O-methyl-L-tyrosine |
| Synonyms | Source |
|---|---|
| β-(3,4-dimethoxyphenyl)-L-alanine | ChEBI |
| 3-(3,4-dimethoxyphenyl)-L-alanine | ChEBI |
| (S)-3,4-dimethoxyphenylalanine | ChEBI |
| (2S)-2-amino-3-(3,4-dimethoxyphenyl)propanoic acid | ChEBI |
| (S)-2-amino-3-(3,4-dimethoxyphenyl)propanoic acid | ChEBI |
| DMPA | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| US3669837 | Patent |
| Registry Numbers | Sources |
|---|---|
| CAS:32161-30-1 | ChEBI |
| Citations |
|---|