EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H16N2O6S |
| Net Charge | 0 |
| Average Mass | 316.335 |
| Monoisotopic Mass | 316.07291 |
| SMILES | N[C@@H](CSc1c(C[C@H](N)C(=O)O)ccc(O)c1O)C(=O)O |
| InChI | InChI=1S/C12H16N2O6S/c13-6(11(17)18)3-5-1-2-8(15)9(16)10(5)21-4-7(14)12(19)20/h1-2,6-7,15-16H,3-4,13-14H2,(H,17,18)(H,19,20)/t6-,7-/m0/s1 |
| InChIKey | IAGPESOLVJAEAG-BQBZGAKWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (891724) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-S-cysteinyl-DOPA (CHEBI:84296) has functional parent L-dopa (CHEBI:15765) |
| 2-S-cysteinyl-DOPA (CHEBI:84296) has role human urinary metabolite (CHEBI:84087) |
| 2-S-cysteinyl-DOPA (CHEBI:84296) is a S-conjugate (CHEBI:64987) |
| 2-S-cysteinyl-DOPA (CHEBI:84296) is a S-organyl-L-cysteine (CHEBI:47912) |
| 2-S-cysteinyl-DOPA (CHEBI:84296) is a L-tyrosine derivative (CHEBI:27177) |
| 2-S-cysteinyl-DOPA (CHEBI:84296) is a amino dicarboxylic acid (CHEBI:36164) |
| 2-S-cysteinyl-DOPA (CHEBI:84296) is a aryl sulfide (CHEBI:35683) |
| 2-S-cysteinyl-DOPA (CHEBI:84296) is a catechols (CHEBI:33566) |
| 2-S-cysteinyl-DOPA (CHEBI:84296) is a diamine (CHEBI:23666) |
| IUPAC Name |
|---|
| 2-{[(2R)-2-amino-2-carboxyethyl]sulfanyl}-3-hydroxy-L-tyrosine |
| Synonyms | Source |
|---|---|
| 2-S-cysteinyldopa | ChEBI |
| 2-S-cysteinyl-3,4-dihydroxyphenylalanine | ChEBI |
| 2-S-Cysteinyldopa | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2179160 | Reaxys |
| CAS:25565-17-7 | ChemIDplus |
| Citations |
|---|