EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H11NO4 |
| Net Charge | 0 |
| Average Mass | 197.190 |
| Monoisotopic Mass | 197.06881 |
| SMILES | NC(Cc1ccc(O)c(O)c1)C(=O)O |
| InChI | InChI=1S/C9H11NO4/c10-6(9(13)14)3-5-1-2-7(11)8(12)4-5/h1-2,4,6,11-12H,3,10H2,(H,13,14) |
| InChIKey | WTDRDQBEARUVNC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dopa (CHEBI:49168) has role human metabolite (CHEBI:77746) |
| dopa (CHEBI:49168) is a hydroxyphenylalanine (CHEBI:24734) |
| dopa (CHEBI:49168) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| dopa (CHEBI:49168) is a tyrosine derivative (CHEBI:62761) |
| Incoming Relation(s) |
| N-methyldopa (CHEBI:167648) has functional parent dopa (CHEBI:49168) |
| 6-hydroxydopa (CHEBI:20725) has functional parent dopa (CHEBI:49168) |
| D-dopa (CHEBI:49169) is a dopa (CHEBI:49168) |
| L-dopa (CHEBI:15765) is a dopa (CHEBI:49168) |
| IUPAC Names |
|---|
| 2-amino-3-(3,4-dihydroxyphenyl)propanoic acid |
| dopa |
| Synonyms | Source |
|---|---|
| (±)-3-(3,4-dihydroxyphenyl)alanine | ChemIDplus |
| 3',4'-dihydroxyphenylalanine | NIST Chemistry WebBook |
| 3-hydroxy-DL-tyrosine | ChemIDplus |
| 3-hydroxytyrosine | IUPAC |
| (±)-dopa | ChemIDplus |
| dl-β-(3,4-dihydroxyphenyl)-α-alanine | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| HMDB0000609 | HMDB |
| Citations |
|---|