EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:15765 - L-dopa
| Formula | C9H11NO4 |
| Net Charge | 0 |
| Average Mass | 197.190 |
| Monoisotopic Mass | 197.06881 |
| SMILES | N[C@@H](Cc1ccc(O)c(O)c1)C(=O)O |
| InChI | InChI=1S/C9H11NO4/c10-6(9(13)14)3-5-1-2-7(11)8(12)4-5/h1-2,4,6,11-12H,3,10H2,(H,13,14)/t6-/m0/s1 |
| InChIKey | WTDRDQBEARUVNC-LURJTMIESA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). neurotoxin A poison that interferes with the functions of the nervous system. allelochemical A class of secondary metabolites developed by many plants to influence the behaviour, growth or survival of herbivores, and thus acting as a defence against herbivory. dopaminergic agent A drug used for its effects on dopamine receptors, on the life cycle of dopamine, or on the survival of dopaminergic neurons. hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| Applications: | dopaminergic agent A drug used for its effects on dopamine receptors, on the life cycle of dopamine, or on the survival of dopaminergic neurons. antidyskinesia agent Any compound which can be used to treat or alleviate the symptoms of dyskinesia. antiparkinson drug A drug used in the treatment of Parkinson's disease. prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-dopa (CHEBI:15765) has role allelochemical (CHEBI:62215) |
| L-dopa (CHEBI:15765) has role antidyskinesia agent (CHEBI:66956) |
| L-dopa (CHEBI:15765) has role antiparkinson drug (CHEBI:48407) |
| L-dopa (CHEBI:15765) has role dopaminergic agent (CHEBI:48560) |
| L-dopa (CHEBI:15765) has role hapten (CHEBI:59174) |
| L-dopa (CHEBI:15765) has role human metabolite (CHEBI:77746) |
| L-dopa (CHEBI:15765) has role mouse metabolite (CHEBI:75771) |
| L-dopa (CHEBI:15765) has role neurotoxin (CHEBI:50910) |
| L-dopa (CHEBI:15765) has role plant growth retardant (CHEBI:35219) |
| L-dopa (CHEBI:15765) has role plant metabolite (CHEBI:76924) |
| L-dopa (CHEBI:15765) has role prodrug (CHEBI:50266) |
| L-dopa (CHEBI:15765) is a L-tyrosine derivative (CHEBI:27177) |
| L-dopa (CHEBI:15765) is a dopa (CHEBI:49168) |
| L-dopa (CHEBI:15765) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| L-dopa (CHEBI:15765) is conjugate acid of L-dopa(1−) (CHEBI:67012) |
| L-dopa (CHEBI:15765) is enantiomer of D-dopa (CHEBI:49169) |
| L-dopa (CHEBI:15765) is tautomer of L-dopa zwitterion (CHEBI:57504) |
| Incoming Relation(s) |
| N-methyl-L-dopa (CHEBI:167646) has functional parent L-dopa (CHEBI:15765) |
| 2-S-cysteinyl-DOPA (CHEBI:84296) has functional parent L-dopa (CHEBI:15765) |
| 2,5-S,S'-dicysteinyldopa (CHEBI:84298) has functional parent L-dopa (CHEBI:15765) |
| 3-O-methyldopa (CHEBI:82913) has functional parent L-dopa (CHEBI:15765) |
| 3,4-dimethoxy-L-phenylalanine (CHEBI:229731) has functional parent L-dopa (CHEBI:15765) |
| 4-O-methyl-L-dopa (CHEBI:193023) has functional parent L-dopa (CHEBI:15765) |
| 6-fluoro-L-dopa (CHEBI:49163) has functional parent L-dopa (CHEBI:15765) |
| 6-hydroxy-L-dopa (CHEBI:72753) has functional parent L-dopa (CHEBI:15765) |
| foslevodopa (CHEBI:192509) has functional parent L-dopa (CHEBI:15765) |
| L-dopa(1−) (CHEBI:67012) is conjugate base of L-dopa (CHEBI:15765) |
| D-dopa (CHEBI:49169) is enantiomer of L-dopa (CHEBI:15765) |
| L-dopa zwitterion (CHEBI:57504) is tautomer of L-dopa (CHEBI:15765) |
| IUPAC Names |
|---|
| L-dopa |
| (2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoic acid |
| INNs | Source |
|---|---|
| levodopa | KEGG DRUG |
| levodopum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 3,4-Dihydroxy-L-phenylalanine | KEGG COMPOUND |
| L-Dopa | KEGG COMPOUND |
| 3-Hydroxy-L-tyrosine | KEGG COMPOUND |
| L-beta-(3,4-Dihydroxyphenyl)alanine | KEGG COMPOUND |
| Dihydroxy-L-phenylalanine | KEGG COMPOUND |
| L-DOPA | NIST Chemistry WebBook |
| Brand Name | Source |
|---|---|
| Dopar | KEGG DRUG |
| Citations |
|---|