EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H7NO2 |
| Net Charge | 0 |
| Average Mass | 161.160 |
| Monoisotopic Mass | 161.04768 |
| SMILES | O=C(O)c1cnc2ccccc12 |
| InChI | InChI=1S/C9H7NO2/c11-9(12)7-5-10-8-4-2-1-3-6(7)8/h1-5,10H,(H,11,12) |
| InChIKey | KMAKOBLIOCQGJP-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (4844607) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| indole-3-carboxylic acid (CHEBI:24809) has role bacterial metabolite (CHEBI:76969) |
| indole-3-carboxylic acid (CHEBI:24809) has role human metabolite (CHEBI:77746) |
| indole-3-carboxylic acid (CHEBI:24809) is a indol-3-yl carboxylic acid (CHEBI:24810) |
| indole-3-carboxylic acid (CHEBI:24809) is conjugate acid of indole-3-carboxylate (CHEBI:62448) |
| Incoming Relation(s) |
| D-glucosyl 6-hydroxyindole-3-carboxylate (CHEBI:65026) has functional parent indole-3-carboxylic acid (CHEBI:24809) |
| D-glucosyl indole-3-carboxylate (CHEBI:65021) has functional parent indole-3-carboxylic acid (CHEBI:24809) |
| 1H-indole-3-carboxylate ester (CHEBI:79025) has functional parent indole-3-carboxylic acid (CHEBI:24809) |
| 3-indole carboxylic acid glucuronide (CHEBI:68486) has functional parent indole-3-carboxylic acid (CHEBI:24809) |
| 4-O-(1H-indol-3-ylcarbonyl)ascaroside (CHEBI:79024) has functional parent indole-3-carboxylic acid (CHEBI:24809) |
| 5-(6-O-malonyl-β-D-glucosyloxy)-indole-3-carboxylic acid (CHEBI:91163) has functional parent indole-3-carboxylic acid (CHEBI:24809) |
| 6-(D-glucosyloxy)indole-3-carboxylic acid (CHEBI:65025) has functional parent indole-3-carboxylic acid (CHEBI:24809) |
| methyl indole-3-carboxylate (CHEBI:65019) has functional parent indole-3-carboxylic acid (CHEBI:24809) |
| tropisetron (CHEBI:32269) has functional parent indole-3-carboxylic acid (CHEBI:24809) |
| indole-3-carboxylate (CHEBI:62448) is conjugate base of indole-3-carboxylic acid (CHEBI:24809) |
| IUPAC Name |
|---|
| 1H-indole-3-carboxylic acid |
| Synonym | Source |
|---|---|
| indole-3-carboxylic acid | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| HMDB0003320 | HMDB |
| ICO | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:129435 | Reaxys |
| Gmelin:1875411 | Gmelin |
| CAS:771-50-6 | ChemIDplus |
| Citations |
|---|