EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H9NO2 |
| Net Charge | 0 |
| Average Mass | 175.187 |
| Monoisotopic Mass | 175.06333 |
| SMILES | COC(=O)c1cnc2ccccc12 |
| InChI | InChI=1S/C10H9NO2/c1-13-10(12)8-6-11-9-5-3-2-4-7(8)9/h2-6,11H,1H3 |
| InChIKey | QXAUTQFAWKKNLM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methyl indole-3-carboxylate (CHEBI:65019) has functional parent indole-3-carboxylic acid (CHEBI:24809) |
| methyl indole-3-carboxylate (CHEBI:65019) has role metabolite (CHEBI:25212) |
| methyl indole-3-carboxylate (CHEBI:65019) is a indoles (CHEBI:24828) |
| methyl indole-3-carboxylate (CHEBI:65019) is a methyl ester (CHEBI:25248) |
| IUPAC Name |
|---|
| methyl 1H-indole-3-carboxylate |
| Synonyms | Source |
|---|---|
| 3-carbomethoxyindole | ChEBI |
| 3-methoxycarbonylindole | ChEBI |
| indole-3-carboxylic acid methyl ester | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPDQT-423 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:142023 | Reaxys |
| Citations |
|---|