EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H17NO8 |
| Net Charge | 0 |
| Average Mass | 339.300 |
| Monoisotopic Mass | 339.09542 |
| SMILES | O=C(O)c1cnc2cc(OC3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)ccc12 |
| InChI | InChI=1S/C15H17NO8/c17-5-10-11(18)12(19)13(20)15(24-10)23-6-1-2-7-8(14(21)22)4-16-9(7)3-6/h1-4,10-13,15-20H,5H2,(H,21,22)/t10-,11-,12+,13-,15?/m1/s1 |
| InChIKey | KVKJZZMEYYZNDI-CKMVWSRUSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-(D-glucosyloxy)indole-3-carboxylic acid (CHEBI:65025) has functional parent indole-3-carboxylic acid (CHEBI:24809) |
| 6-(D-glucosyloxy)indole-3-carboxylic acid (CHEBI:65025) has role metabolite (CHEBI:25212) |
| 6-(D-glucosyloxy)indole-3-carboxylic acid (CHEBI:65025) is a D-glucoside (CHEBI:35436) |
| 6-(D-glucosyloxy)indole-3-carboxylic acid (CHEBI:65025) is a indolyl carbohydrate (CHEBI:24821) |
| IUPAC Name |
|---|
| 6-(D-glucopyranosyloxy)-1H-indole-3-carboxylic acid |
| Synonyms | Source |
|---|---|
| 6-GlcO-I3CO2H | ChEBI |
| 6-glucosyloxyindole-3-carboxylic acid | ChEBI |
| Citations |
|---|