EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H20N2O2 |
| Net Charge | 0 |
| Average Mass | 284.359 |
| Monoisotopic Mass | 284.15248 |
| SMILES | [H][C@]12CC[C@]([H])(C[C@H](OC(=O)c3cnc4ccccc34)C1)N2C |
| InChI | InChI=1S/C17H20N2O2/c1-19-11-6-7-12(19)9-13(8-11)21-17(20)15-10-18-16-5-3-2-4-14(15)16/h2-5,10-13,18H,6-9H2,1H3/t11-,12+,13+ |
| InChIKey | ZNRGQMMCGHDTEI-ITGUQSILSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | immunomodulator Biologically active substance whose activity affects or plays a role in the functioning of the immune system. nicotinic acetylcholine receptor agonist An agonist that selectively binds to and activates a nicotinic acetylcholine receptor. apoptosis inhibitor Any substance that inhibits the process of apoptosis (programmed cell death) in multi-celled organisms. serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. trypanocidal drug A drug used to treat or prevent infections caused by protozoal organisms belonging to the suborder Trypanosomatida. |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. immunomodulator Biologically active substance whose activity affects or plays a role in the functioning of the immune system. antiemetic A drug used to prevent nausea or vomiting. An antiemetic may act by a wide range of mechanisms: it might affect the medullary control centres (the vomiting centre and the chemoreceptive trigger zone) or affect the peripheral receptors. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. nicotinic acetylcholine receptor agonist An agonist that selectively binds to and activates a nicotinic acetylcholine receptor. serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. trypanocidal drug A drug used to treat or prevent infections caused by protozoal organisms belonging to the suborder Trypanosomatida. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tropisetron (CHEBI:32269) has functional parent indole-3-carboxylic acid (CHEBI:24809) |
| tropisetron (CHEBI:32269) has functional parent tropine (CHEBI:15884) |
| tropisetron (CHEBI:32269) has role anti-inflammatory agent (CHEBI:67079) |
| tropisetron (CHEBI:32269) has role antiemetic (CHEBI:50919) |
| tropisetron (CHEBI:32269) has role apoptosis inhibitor (CHEBI:68494) |
| tropisetron (CHEBI:32269) has role immunomodulator (CHEBI:50846) |
| tropisetron (CHEBI:32269) has role neuroprotective agent (CHEBI:63726) |
| tropisetron (CHEBI:32269) has role nicotinic acetylcholine receptor agonist (CHEBI:47958) |
| tropisetron (CHEBI:32269) has role serotonergic antagonist (CHEBI:48279) |
| tropisetron (CHEBI:32269) has role trypanocidal drug (CHEBI:36335) |
| tropisetron (CHEBI:32269) is a azabicycloalkane (CHEBI:38295) |
| tropisetron (CHEBI:32269) is a indolyl carboxylate ester (CHEBI:46939) |
| tropisetron (CHEBI:32269) is a tertiary amino compound (CHEBI:50996) |
| tropisetron (CHEBI:32269) is conjugate base of tropisetron(1+) (CHEBI:77571) |
| Incoming Relation(s) |
| tropisetron(1+) (CHEBI:77571) is conjugate acid of tropisetron (CHEBI:32269) |
| IUPAC Name |
|---|
| (3-endo)-8-methyl-8-azabicyclo[3.2.1]oct-3-yl 1H-indole-3-carboxylate |
| INNs | Source |
|---|---|
| tropisetron | ChemIDplus |
| tropisetronum | ChemIDplus |
| Synonym | Source |
|---|---|
| 1alphaH,5alphaH-Tropan-3alpha-yl indole-3-carboxylate | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 2775 | DrugCentral |
| C13666 | KEGG COMPOUND |
| D02130 | KEGG DRUG |
| TKT | PDBeChem |
| Tropisetron | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3619989 | Reaxys |
| CAS:89565-68-4 | KEGG COMPOUND |
| CAS:89565-68-4 | ChemIDplus |
| Citations |
|---|