EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:32269 - tropisetron
| Formula | C17H20N2O2 |
| Net Charge | 0 |
| Average Mass | 284.359 |
| Monoisotopic Mass | 284.15248 |
| SMILES | [H][C@]12CC[C@]([H])(C[C@H](OC(=O)c3cnc4ccccc34)C1)N2C |
| InChI | InChI=1S/C17H20N2O2/c1-19-11-6-7-12(19)9-13(8-11)21-17(20)15-10-18-16-5-3-2-4-14(15)16/h2-5,10-13,18H,6-9H2,1H3/t11-,12+,13+ |
| InChIKey | ZNRGQMMCGHDTEI-ITGUQSILSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | trypanocidal drug A drug used to treat or prevent infections caused by protozoal organisms belonging to the suborder Trypanosomatida. nicotinic acetylcholine receptor agonist An agonist that selectively binds to and activates a nicotinic acetylcholine receptor. immunomodulator Biologically active substance whose activity affects or plays a role in the functioning of the immune system. apoptosis inhibitor Any substance that inhibits the process of apoptosis (programmed cell death) in multi-celled organisms. serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. antiemetic A drug used to prevent nausea or vomiting. An antiemetic may act by a wide range of mechanisms: it might affect the medullary control centres (the vomiting centre and the chemoreceptive trigger zone) or affect the peripheral receptors. trypanocidal drug A drug used to treat or prevent infections caused by protozoal organisms belonging to the suborder Trypanosomatida. nicotinic acetylcholine receptor agonist An agonist that selectively binds to and activates a nicotinic acetylcholine receptor. immunomodulator Biologically active substance whose activity affects or plays a role in the functioning of the immune system. serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tropisetron (CHEBI:32269) has functional parent indole-3-carboxylic acid (CHEBI:24809) |
| tropisetron (CHEBI:32269) has functional parent tropine (CHEBI:15884) |
| tropisetron (CHEBI:32269) has role anti-inflammatory agent (CHEBI:67079) |
| tropisetron (CHEBI:32269) has role antiemetic (CHEBI:50919) |
| tropisetron (CHEBI:32269) has role apoptosis inhibitor (CHEBI:68494) |
| tropisetron (CHEBI:32269) has role immunomodulator (CHEBI:50846) |
| tropisetron (CHEBI:32269) has role neuroprotective agent (CHEBI:63726) |
| tropisetron (CHEBI:32269) has role nicotinic acetylcholine receptor agonist (CHEBI:47958) |
| tropisetron (CHEBI:32269) has role serotonergic antagonist (CHEBI:48279) |
| tropisetron (CHEBI:32269) has role trypanocidal drug (CHEBI:36335) |
| tropisetron (CHEBI:32269) is a azabicycloalkane (CHEBI:38295) |
| tropisetron (CHEBI:32269) is a indolyl carboxylate ester (CHEBI:46939) |
| tropisetron (CHEBI:32269) is a tertiary amino compound (CHEBI:50996) |
| tropisetron (CHEBI:32269) is conjugate base of tropisetron(1+) (CHEBI:77571) |
| Incoming Relation(s) |
| tropisetron(1+) (CHEBI:77571) is conjugate acid of tropisetron (CHEBI:32269) |
| IUPAC Name |
|---|
| (3-endo)-8-methyl-8-azabicyclo[3.2.1]oct-3-yl 1H-indole-3-carboxylate |
| INNs | Source |
|---|---|
| tropisetron | ChemIDplus |
| tropisetronum | ChemIDplus |
| Synonym | Source |
|---|---|
| 1alphaH,5alphaH-Tropan-3alpha-yl indole-3-carboxylate | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 2775 | DrugCentral |
| C13666 | KEGG COMPOUND |
| D02130 | KEGG DRUG |
| TKT | PDBeChem |
| Tropisetron | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3619989 | Reaxys |
| CAS:89565-68-4 | KEGG COMPOUND |
| CAS:89565-68-4 | ChemIDplus |
| Citations |
|---|