EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H19NO11 |
| Net Charge | 0 |
| Average Mass | 425.346 |
| Monoisotopic Mass | 425.09581 |
| SMILES | O=C(O)CC(=O)OC[C@H]1O[C@@H](Oc2ccc3ncc(C(=O)O)c3c2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H19NO11/c20-12(21)4-13(22)28-6-11-14(23)15(24)16(25)18(30-11)29-7-1-2-10-8(3-7)9(5-19-10)17(26)27/h1-3,5,11,14-16,18-19,23-25H,4,6H2,(H,20,21)(H,26,27)/t11-,14-,15+,16-,18-/m1/s1 |
| InChIKey | WXIACXAKMZPXKX-AJZPPWIDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | |||
| root (BTO:0001188) | PubMed (25457500) | ||
| root (BTO:0001188) | MetaboLights (MTBLS160) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-(6-O-malonyl-β-D-glucosyloxy)-indole-3-carboxylic acid (CHEBI:91163) has functional parent indole-3-carboxylic acid (CHEBI:24809) |
| 5-(6-O-malonyl-β-D-glucosyloxy)-indole-3-carboxylic acid (CHEBI:91163) has role plant metabolite (CHEBI:76924) |
| 5-(6-O-malonyl-β-D-glucosyloxy)-indole-3-carboxylic acid (CHEBI:91163) is a dicarboxylic acid (CHEBI:35692) |
| 5-(6-O-malonyl-β-D-glucosyloxy)-indole-3-carboxylic acid (CHEBI:91163) is a indolyl carbohydrate (CHEBI:24821) |
| 5-(6-O-malonyl-β-D-glucosyloxy)-indole-3-carboxylic acid (CHEBI:91163) is a indolyl carboxylic acid (CHEBI:46867) |
| 5-(6-O-malonyl-β-D-glucosyloxy)-indole-3-carboxylic acid (CHEBI:91163) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| 5-{[6-O-(carboxyacetyl)-β-D-glucopyranosyl]oxy}-1H-indole-3-carboxylic acid |
| Synonym | Source |
|---|---|
| 6-(Malonyl-GlcO)-I3CO2H | ChEBI |
| Citations |
|---|