EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H15NO8 |
| Net Charge | 0 |
| Average Mass | 337.284 |
| Monoisotopic Mass | 337.07977 |
| SMILES | O=C(O[C@@H]1O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]1O)c1cnc2ccccc12 |
| InChI | InChI=1S/C15H15NO8/c17-9-10(18)12(13(20)21)23-15(11(9)19)24-14(22)7-5-16-8-4-2-1-3-6(7)8/h1-5,9-12,15-19H,(H,20,21)/t9-,10-,11+,12-,15-/m0/s1 |
| InChIKey | BDNWJTRKUBXAGH-HJHSNUOESA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-indole carboxylic acid glucuronide (CHEBI:68486) has functional parent indole-3-carboxylic acid (CHEBI:24809) |
| 3-indole carboxylic acid glucuronide (CHEBI:68486) has functional parent β-D-glucuronic acid (CHEBI:28860) |
| 3-indole carboxylic acid glucuronide (CHEBI:68486) has role metabolite (CHEBI:25212) |
| 3-indole carboxylic acid glucuronide (CHEBI:68486) is a O-acyl carbohydrate (CHEBI:52782) |
| 3-indole carboxylic acid glucuronide (CHEBI:68486) is a glucosiduronic acid (CHEBI:24302) |
| 3-indole carboxylic acid glucuronide (CHEBI:68486) is a indolyl carbohydrate (CHEBI:24821) |
| IUPAC Name |
|---|
| 1-O-(1H-indol-3-ylcarbonyl)-β-D-glucopyranuronic acid |
| Manual Xrefs | Databases |
|---|---|
| HMDB0013189 | HMDB |
| Citations |
|---|