EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H17NO8 |
| Net Charge | 0 |
| Average Mass | 339.300 |
| Monoisotopic Mass | 339.09542 |
| SMILES | O=C(OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)c1cnc2cc(O)ccc12 |
| InChI | InChI=1S/C15H17NO8/c17-5-10-11(19)12(20)13(21)15(23-10)24-14(22)8-4-16-9-3-6(18)1-2-7(8)9/h1-4,10-13,15-21H,5H2/t10-,11-,12+,13-,15?/m1/s1 |
| InChIKey | VZZSVZUINKFSIE-CKMVWSRUSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-glucosyl 6-hydroxyindole-3-carboxylate (CHEBI:65026) has functional parent indole-3-carboxylic acid (CHEBI:24809) |
| D-glucosyl 6-hydroxyindole-3-carboxylate (CHEBI:65026) has role metabolite (CHEBI:25212) |
| D-glucosyl 6-hydroxyindole-3-carboxylate (CHEBI:65026) is a O-acyl carbohydrate (CHEBI:52782) |
| D-glucosyl 6-hydroxyindole-3-carboxylate (CHEBI:65026) is a D-glucoside (CHEBI:35436) |
| D-glucosyl 6-hydroxyindole-3-carboxylate (CHEBI:65026) is a indolyl carbohydrate (CHEBI:24821) |
| IUPAC Names |
|---|
| 1-O-[(6-hydroxy-1H-indol-3-yl)carbonyl]-D-glucopyranose |
| 3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl 6-hydroxy-1H-indole-3-carboxylate |
| Synonyms | Source |
|---|---|
| 1-(6-hydroxyindol-3-ylcarbonyl)-D-glucose | ChEBI |
| 6-OH-I3CO2Glc | ChEBI |
| Citations |
|---|