EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H17NO7 |
| Net Charge | 0 |
| Average Mass | 323.301 |
| Monoisotopic Mass | 323.10050 |
| SMILES | O=C(OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)c1cnc2ccccc12 |
| InChI | InChI=1S/C15H17NO7/c17-6-10-11(18)12(19)13(20)15(22-10)23-14(21)8-5-16-9-4-2-1-3-7(8)9/h1-5,10-13,15-20H,6H2/t10-,11-,12+,13-,15?/m1/s1 |
| InChIKey | OQZPHKHJQADXAS-CKMVWSRUSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-glucosyl indole-3-carboxylate (CHEBI:65021) has functional parent indole-3-carboxylic acid (CHEBI:24809) |
| D-glucosyl indole-3-carboxylate (CHEBI:65021) has role metabolite (CHEBI:25212) |
| D-glucosyl indole-3-carboxylate (CHEBI:65021) is a O-acyl carbohydrate (CHEBI:52782) |
| D-glucosyl indole-3-carboxylate (CHEBI:65021) is a D-glucoside (CHEBI:35436) |
| D-glucosyl indole-3-carboxylate (CHEBI:65021) is a indolyl carbohydrate (CHEBI:24821) |
| IUPAC Name |
|---|
| 1-O-(1H-indol-3-ylcarbonyl)-D-glucopyranose |
| Synonyms | Source |
|---|---|
| 1-(indol-3-ylcarbonyl)-D-glucose | ChEBI |
| I3CO2Glc | ChEBI |
| Citations |
|---|